C24H22ClFN4O2 — CID 130362613
4-(1-but-2-ynoyl-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-6-yl)-6-chloro-3-fluoro-9H-carbazole-1-carboxamide (PubChem CID 130362613) has the molecular formula C24H22ClFN4O2 and a molecular weight of 452.92 g/mol. Its IUPAC name is 4-(1-but-2-ynoyl-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-6-yl)-6-chloro-3-fluoro-9H-carbazole-1-carboxamide.
| Compound Name | 4-(1-but-2-ynoyl-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-6-yl)-6-chloro-3-fluoro-9H-carbazole-1-carboxamide |
|---|---|
| PubChem CID | 130362613 |
| Molecular Formula | C24H22ClFN4O2 |
| Molecular Weight | 452.92 g/mol |
| Exact Mass | 452.14 |
| IUPAC Name | 4-(1-but-2-ynoyl-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-6-yl)-6-chloro-3-fluoro-9H-carbazole-1-carboxamide |
| SMILES | CC#CC(=O)N1CCCC2CN(c3c(F)cc(C(N)=O)c4[nH]c5ccc(Cl)cc5c34)CC21 |
| InChI | InChI=1S/C24H22ClFN4O2/c1-2-4-20(31)30-8-3-5-13-11-29(12-19(13)30)23-17(26)10-16(24(27)32)22-21(23)15-9-14(25)6-7-18(15)28-22/h6-7,9-10,13,19,28H,3,5,8,11-12H2,1H3,(H2,27,32) |
| InChIKey | BLVZZOWAJQXUTI-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 82.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.92 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|