About 9-[2,2-bis(diethoxyphosphoryl)ethenyl]anthracene
9-[2,2-bis(diethoxyphosphoryl)ethenyl]anthracene (PubChem CID 130362615) has the molecular formula C24H30O6P2
and a molecular weight of 476.45 g/mol. Its IUPAC name is 9-[2,2-bis(diethoxyphosphoryl)ethenyl]anthracene.
Molecular Properties
| Compound Name | 9-[2,2-bis(diethoxyphosphoryl)ethenyl]anthracene |
| PubChem CID | 130362615 |
| Molecular Formula | C24H30O6P2 |
| Molecular Weight | 476.45 g/mol |
| Exact Mass | 476.15 |
| IUPAC Name | 9-[2,2-bis(diethoxyphosphoryl)ethenyl]anthracene |
| SMILES | CCOP(=O)(OCC)C(=Cc1c2ccccc2cc2ccccc12)P(=O)(OCC)OCC |
| InChI | InChI=1S/C24H30O6P2/c1-5-27-31(25,28-6-2)24(32(26,29-7-3)30-8-4)18-23-21-15-11-9-13-19(21)17-20-14-10-12-16-22(20)23/h9-18H,5-8H2,1-4H3 |
| InChIKey | FFBFZSFLAOADHS-UHFFFAOYSA-N |
| XLogP | 7.82 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 476.45 |
| LogP ≤ 5 | 7.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 9-[2,2-bis(diethoxyphosphoryl)ethenyl]anthracene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-[2,2-bis(diethoxyphosphoryl)ethenyl]anthracene?
The IUPAC name of 9-[2,2-bis(diethoxyphosphoryl)ethenyl]anthracene (CID 130362615) is 9-[2,2-bis(diethoxyphosphoryl)ethenyl]anthracene.
What is the SMILES notation for 9-[2,2-bis(diethoxyphosphoryl)ethenyl]anthracene?
The canonical SMILES for 9-[2,2-bis(diethoxyphosphoryl)ethenyl]anthracene is CCOP(=O)(OCC)C(=Cc1c2ccccc2cc2ccccc12)P(=O)(OCC)OCC.
What is the InChIKey of 9-[2,2-bis(diethoxyphosphoryl)ethenyl]anthracene?
The InChIKey is FFBFZSFLAOADHS-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H30O6P2/c1-5-27-31(25,28-6-2)24(32(26,29-7-3)30-8-4)18-23-21-15-11-9-13-19(21)17-20-14-10-12-16-22(20)23/h9-18H,5-8H2,1-4H3.
What are the key properties of 9-[2,2-bis(diethoxyphosphoryl)ethenyl]anthracene?
9-[2,2-bis(diethoxyphosphoryl)ethenyl]anthracene has a molecular weight of 476.45 g/mol, XLogP of 7.82, 11 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 9-[2,2-bis(diethoxyphosphoryl)ethenyl]anthracene is sourced from PubChem (CID 130362615), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).