C20H27NO3 — CID 130362650
N-tert-butyl-2-[2,4-dioxo-3-(2,4,6-trimethylphenyl)cyclopentyl]acetamide (PubChem CID 130362650) has the molecular formula C20H27NO3 and a molecular weight of 329.44 g/mol. Its IUPAC name is N-tert-butyl-2-[2,4-dioxo-3-(2,4,6-trimethylphenyl)cyclopentyl]acetamide.
| Compound Name | N-tert-butyl-2-[2,4-dioxo-3-(2,4,6-trimethylphenyl)cyclopentyl]acetamide |
|---|---|
| PubChem CID | 130362650 |
| Molecular Formula | C20H27NO3 |
| Molecular Weight | 329.44 g/mol |
| Exact Mass | 329.20 |
| IUPAC Name | N-tert-butyl-2-[2,4-dioxo-3-(2,4,6-trimethylphenyl)cyclopentyl]acetamide |
| SMILES | Cc1cc(C)c(C2C(=O)CC(CC(=O)NC(C)(C)C)C2=O)c(C)c1 |
| InChI | InChI=1S/C20H27NO3/c1-11-7-12(2)17(13(3)8-11)18-15(22)9-14(19(18)24)10-16(23)21-20(4,5)6/h7-8,14,18H,9-10H2,1-6H3,(H,21,23) |
| InChIKey | AETVRWOZUOWEND-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.44 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|