C21H22F3N7O2 — CID 130362778
(6S)-4-acetyl-1-[4-[4-amino-5-(trifluoromethyl)pyrrolo[2,1-f][1,2,4]triazin-7-yl]-2-pyridinyl]-3,3,6-trimethylpiperazin-2-one (PubChem CID 130362778) has the molecular formula C21H22F3N7O2 and a molecular weight of 461.45 g/mol. Its IUPAC name is (6S)-4-acetyl-1-[4-[4-amino-5-(trifluoromethyl)pyrrolo[2,1-f][1,2,4]triazin-7-yl]-2-pyridinyl]-3,3,6-trimethylpiperazin-2-one.
| Compound Name | (6S)-4-acetyl-1-[4-[4-amino-5-(trifluoromethyl)pyrrolo[2,1-f][1,2,4]triazin-7-yl]-2-pyridinyl]-3,3,6-trimethylpiperazin-2-one |
|---|---|
| PubChem CID | 130362778 |
| Molecular Formula | C21H22F3N7O2 |
| Molecular Weight | 461.45 g/mol |
| Exact Mass | 461.18 |
| IUPAC Name | (6S)-4-acetyl-1-[4-[4-amino-5-(trifluoromethyl)pyrrolo[2,1-f][1,2,4]triazin-7-yl]-2-pyridinyl]-3,3,6-trimethylpiperazin-2-one |
| SMILES | CC(=O)N1C[C@H](C)N(c2cc(-c3cc(C(F)(F)F)c4c(N)ncnn34)ccn2)C(=O)C1(C)C |
| InChI | InChI=1S/C21H22F3N7O2/c1-11-9-29(12(2)32)20(3,4)19(33)30(11)16-7-13(5-6-26-16)15-8-14(21(22,23)24)17-18(25)27-10-28-31(15)17/h5-8,10-11H,9H2,1-4H3,(H2,25,27,28)/t11-/m0/s1 |
| InChIKey | SISNRECOUBMQMK-NSHDSACASA-N |
| XLogP | 2.75 |
| TPSA | 109.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.45 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |