C24H24F5N7O3 — CID 130362907
2-(4-acetyl-3,3-dimethyl-2-oxopiperazin-1-yl)-4-[4-amino-5-(trifluoromethyl)pyrrolo[2,1-f][1,2,4]triazin-7-yl]-N-(2,2-difluoroethyl)benzamide (PubChem CID 130362907) has the molecular formula C24H24F5N7O3 and a molecular weight of 553.49 g/mol. Its IUPAC name is 2-(4-acetyl-3,3-dimethyl-2-oxopiperazin-1-yl)-4-[4-amino-5-(trifluoromethyl)pyrrolo[2,1-f][1,2,4]triazin-7-yl]-N-(2,2-difluoroethyl)benzamide.
| Compound Name | 2-(4-acetyl-3,3-dimethyl-2-oxopiperazin-1-yl)-4-[4-amino-5-(trifluoromethyl)pyrrolo[2,1-f][1,2,4]triazin-7-yl]-N-(2,2-difluoroethyl)benzamide |
|---|---|
| PubChem CID | 130362907 |
| Molecular Formula | C24H24F5N7O3 |
| Molecular Weight | 553.49 g/mol |
| Exact Mass | 553.19 |
| IUPAC Name | 2-(4-acetyl-3,3-dimethyl-2-oxopiperazin-1-yl)-4-[4-amino-5-(trifluoromethyl)pyrrolo[2,1-f][1,2,4]triazin-7-yl]-N-(2,2-difluoroethyl)benzamide |
| SMILES | CC(=O)N1CCN(c2cc(-c3cc(C(F)(F)F)c4c(N)ncnn34)ccc2C(=O)NCC(F)F)C(=O)C1(C)C |
| InChI | InChI=1S/C24H24F5N7O3/c1-12(37)35-7-6-34(22(39)23(35,2)3)17-8-13(4-5-14(17)21(38)31-10-18(25)26)16-9-15(24(27,28)29)19-20(30)32-11-33-36(16)19/h4-5,8-9,11,18H,6-7,10H2,1-3H3,(H,31,38)(H2,30,32,33) |
| InChIKey | MQTPIFIQLNQDTL-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 125.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.49 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |