C21H19F3N6O2 — CID 130363026
4-[4-amino-5-(trifluoromethyl)pyrrolo[2,1-f][1,2,4]triazin-7-yl]-2-(2,2,5-trimethyl-3-oxomorpholin-4-yl)benzonitrile (PubChem CID 130363026) has the molecular formula C21H19F3N6O2 and a molecular weight of 444.42 g/mol. Its IUPAC name is 4-[4-amino-5-(trifluoromethyl)pyrrolo[2,1-f][1,2,4]triazin-7-yl]-2-(2,2,5-trimethyl-3-oxomorpholin-4-yl)benzonitrile.
| Compound Name | 4-[4-amino-5-(trifluoromethyl)pyrrolo[2,1-f][1,2,4]triazin-7-yl]-2-(2,2,5-trimethyl-3-oxomorpholin-4-yl)benzonitrile |
|---|---|
| PubChem CID | 130363026 |
| Molecular Formula | C21H19F3N6O2 |
| Molecular Weight | 444.42 g/mol |
| Exact Mass | 444.15 |
| IUPAC Name | 4-[4-amino-5-(trifluoromethyl)pyrrolo[2,1-f][1,2,4]triazin-7-yl]-2-(2,2,5-trimethyl-3-oxomorpholin-4-yl)benzonitrile |
| SMILES | CC1COC(C)(C)C(=O)N1c1cc(-c2cc(C(F)(F)F)c3c(N)ncnn23)ccc1C#N |
| InChI | InChI=1S/C21H19F3N6O2/c1-11-9-32-20(2,3)19(31)29(11)15-6-12(4-5-13(15)8-25)16-7-14(21(22,23)24)17-18(26)27-10-28-30(16)17/h4-7,10-11H,9H2,1-3H3,(H2,26,27,28) |
| InChIKey | ZCTOUSIBFSPSOQ-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 109.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.42 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |