C19H18ClN7O — CID 130363169
7-(2-chloro-4-pyridinyl)-5-[2-(oxan-4-yl)pyrazol-3-yl]pyrrolo[2,1-f][1,2,4]triazin-4-amine (PubChem CID 130363169) has the molecular formula C19H18ClN7O and a molecular weight of 395.85 g/mol. Its IUPAC name is 7-(2-chloro-4-pyridinyl)-5-[2-(oxan-4-yl)pyrazol-3-yl]pyrrolo[2,1-f][1,2,4]triazin-4-amine.
| Compound Name | 7-(2-chloro-4-pyridinyl)-5-[2-(oxan-4-yl)pyrazol-3-yl]pyrrolo[2,1-f][1,2,4]triazin-4-amine |
|---|---|
| PubChem CID | 130363169 |
| Molecular Formula | C19H18ClN7O |
| Molecular Weight | 395.85 g/mol |
| Exact Mass | 395.13 |
| IUPAC Name | 7-(2-chloro-4-pyridinyl)-5-[2-(oxan-4-yl)pyrazol-3-yl]pyrrolo[2,1-f][1,2,4]triazin-4-amine |
| SMILES | Nc1ncnn2c(-c3ccnc(Cl)c3)cc(-c3ccnn3C3CCOCC3)c12 |
| InChI | InChI=1S/C19H18ClN7O/c20-17-9-12(1-5-22-17)16-10-14(18-19(21)23-11-25-27(16)18)15-2-6-24-26(15)13-3-7-28-8-4-13/h1-2,5-6,9-11,13H,3-4,7-8H2,(H2,21,23,25) |
| InChIKey | FTHXVRDXEWIZOM-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 96.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.85 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|