C24H24F3N7O2 — CID 130363175
(5R)-4-[3-[4-amino-5-[2-(2,2,2-trifluoroethyl)pyrazol-3-yl]pyrrolo[2,1-f][1,2,4]triazin-7-yl]phenyl]-2,2,5-trimethylmorpholin-3-one (PubChem CID 130363175) has the molecular formula C24H24F3N7O2 and a molecular weight of 499.50 g/mol. Its IUPAC name is (5R)-4-[3-[4-amino-5-[2-(2,2,2-trifluoroethyl)pyrazol-3-yl]pyrrolo[2,1-f][1,2,4]triazin-7-yl]phenyl]-2,2,5-trimethylmorpholin-3-one.
| Compound Name | (5R)-4-[3-[4-amino-5-[2-(2,2,2-trifluoroethyl)pyrazol-3-yl]pyrrolo[2,1-f][1,2,4]triazin-7-yl]phenyl]-2,2,5-trimethylmorpholin-3-one |
|---|---|
| PubChem CID | 130363175 |
| Molecular Formula | C24H24F3N7O2 |
| Molecular Weight | 499.50 g/mol |
| Exact Mass | 499.19 |
| IUPAC Name | (5R)-4-[3-[4-amino-5-[2-(2,2,2-trifluoroethyl)pyrazol-3-yl]pyrrolo[2,1-f][1,2,4]triazin-7-yl]phenyl]-2,2,5-trimethylmorpholin-3-one |
| SMILES | C[C@@H]1COC(C)(C)C(=O)N1c1cccc(-c2cc(-c3ccnn3CC(F)(F)F)c3c(N)ncnn23)c1 |
| InChI | InChI=1S/C24H24F3N7O2/c1-14-11-36-23(2,3)22(35)33(14)16-6-4-5-15(9-16)19-10-17(20-21(28)29-13-31-34(19)20)18-7-8-30-32(18)12-24(25,26)27/h4-10,13-14H,11-12H2,1-3H3,(H2,28,29,31)/t14-/m1/s1 |
| InChIKey | UVBGONUDHDGMQG-CQSZACIVSA-N |
| XLogP | 3.93 |
| TPSA | 103.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.50 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |