C24H23F4N7O2 — CID 130363202
(6S)-4-[5-[4-amino-5-[2-(2,2,2-trifluoroethyl)pyrazol-3-yl]pyrrolo[2,1-f][1,2,4]triazin-7-yl]-2-fluorophenyl]-2,2,6-trimethylmorpholin-3-one (PubChem CID 130363202) has the molecular formula C24H23F4N7O2 and a molecular weight of 517.49 g/mol. Its IUPAC name is (6S)-4-[5-[4-amino-5-[2-(2,2,2-trifluoroethyl)pyrazol-3-yl]pyrrolo[2,1-f][1,2,4]triazin-7-yl]-2-fluorophenyl]-2,2,6-trimethylmorpholin-3-one.
| Compound Name | (6S)-4-[5-[4-amino-5-[2-(2,2,2-trifluoroethyl)pyrazol-3-yl]pyrrolo[2,1-f][1,2,4]triazin-7-yl]-2-fluorophenyl]-2,2,6-trimethylmorpholin-3-one |
|---|---|
| PubChem CID | 130363202 |
| Molecular Formula | C24H23F4N7O2 |
| Molecular Weight | 517.49 g/mol |
| Exact Mass | 517.18 |
| IUPAC Name | (6S)-4-[5-[4-amino-5-[2-(2,2,2-trifluoroethyl)pyrazol-3-yl]pyrrolo[2,1-f][1,2,4]triazin-7-yl]-2-fluorophenyl]-2,2,6-trimethylmorpholin-3-one |
| SMILES | C[C@H]1CN(c2cc(-c3cc(-c4ccnn4CC(F)(F)F)c4c(N)ncnn34)ccc2F)C(=O)C(C)(C)O1 |
| InChI | InChI=1S/C24H23F4N7O2/c1-13-10-33(22(36)23(2,3)37-13)19-8-14(4-5-16(19)25)18-9-15(20-21(29)30-12-32-35(18)20)17-6-7-31-34(17)11-24(26,27)28/h4-9,12-13H,10-11H2,1-3H3,(H2,29,30,32)/t13-/m0/s1 |
| InChIKey | WTLIVXFHVMTOCU-ZDUSSCGKSA-N |
| XLogP | 4.07 |
| TPSA | 103.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.49 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |