C24H24F4N8O3S — CID 130363445
1-[3-[4-amino-5-[2-(2,2,2-trifluoroethyl)pyrazol-3-yl]pyrrolo[2,1-f][1,2,4]triazin-7-yl]-2-fluorophenyl]-3,3-dimethyl-4-methylsulfonylpiperazin-2-one (PubChem CID 130363445) has the molecular formula C24H24F4N8O3S and a molecular weight of 580.57 g/mol. Its IUPAC name is 1-[3-[4-amino-5-[2-(2,2,2-trifluoroethyl)pyrazol-3-yl]pyrrolo[2,1-f][1,2,4]triazin-7-yl]-2-fluorophenyl]-3,3-dimethyl-4-methylsulfonylpiperazin-2-one.
| Compound Name | 1-[3-[4-amino-5-[2-(2,2,2-trifluoroethyl)pyrazol-3-yl]pyrrolo[2,1-f][1,2,4]triazin-7-yl]-2-fluorophenyl]-3,3-dimethyl-4-methylsulfonylpiperazin-2-one |
|---|---|
| PubChem CID | 130363445 |
| Molecular Formula | C24H24F4N8O3S |
| Molecular Weight | 580.57 g/mol |
| Exact Mass | 580.16 |
| IUPAC Name | 1-[3-[4-amino-5-[2-(2,2,2-trifluoroethyl)pyrazol-3-yl]pyrrolo[2,1-f][1,2,4]triazin-7-yl]-2-fluorophenyl]-3,3-dimethyl-4-methylsulfonylpiperazin-2-one |
| SMILES | CC1(C)C(=O)N(c2cccc(-c3cc(-c4ccnn4CC(F)(F)F)c4c(N)ncnn34)c2F)CCN1S(C)(=O)=O |
| InChI | InChI=1S/C24H24F4N8O3S/c1-23(2)22(37)33(9-10-35(23)40(3,38)39)17-6-4-5-14(19(17)25)18-11-15(20-21(29)30-13-32-36(18)20)16-7-8-31-34(16)12-24(26,27)28/h4-8,11,13H,9-10,12H2,1-3H3,(H2,29,30,32) |
| InChIKey | IUJIGGFATYBVKJ-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 131.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.57 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |