C22H21F3N6O2 — CID 130363568
4-[4-amino-5-(trifluoromethyl)pyrrolo[2,1-f][1,2,4]triazin-7-yl]-2-[(5S,6S)-2,2,5,6-tetramethyl-3-oxomorpholin-4-yl]benzonitrile (PubChem CID 130363568) has the molecular formula C22H21F3N6O2 and a molecular weight of 458.44 g/mol. Its IUPAC name is 4-[4-amino-5-(trifluoromethyl)pyrrolo[2,1-f][1,2,4]triazin-7-yl]-2-[(5S,6S)-2,2,5,6-tetramethyl-3-oxomorpholin-4-yl]benzonitrile.
| Compound Name | 4-[4-amino-5-(trifluoromethyl)pyrrolo[2,1-f][1,2,4]triazin-7-yl]-2-[(5S,6S)-2,2,5,6-tetramethyl-3-oxomorpholin-4-yl]benzonitrile |
|---|---|
| PubChem CID | 130363568 |
| Molecular Formula | C22H21F3N6O2 |
| Molecular Weight | 458.44 g/mol |
| Exact Mass | 458.17 |
| IUPAC Name | 4-[4-amino-5-(trifluoromethyl)pyrrolo[2,1-f][1,2,4]triazin-7-yl]-2-[(5S,6S)-2,2,5,6-tetramethyl-3-oxomorpholin-4-yl]benzonitrile |
| SMILES | C[C@@H]1OC(C)(C)C(=O)N(c2cc(-c3cc(C(F)(F)F)c4c(N)ncnn34)ccc2C#N)[C@H]1C |
| InChI | InChI=1S/C22H21F3N6O2/c1-11-12(2)33-21(3,4)20(32)30(11)16-7-13(5-6-14(16)9-26)17-8-15(22(23,24)25)18-19(27)28-10-29-31(17)18/h5-8,10-12H,1-4H3,(H2,27,28,29)/t11-,12-/m0/s1 |
| InChIKey | HNKLUXSZXIDIAN-RYUDHWBXSA-N |
| XLogP | 3.79 |
| TPSA | 109.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.44 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |