C28H34N8O3 — CID 130363602
1-[(3R,5S)-4-[3-[4-amino-5-[2-(oxan-4-yl)pyrazol-3-yl]pyrrolo[2,1-f][1,2,4]triazin-7-yl]phenyl]-3,5-dimethylpiperazin-1-yl]-2-hydroxyethanone (PubChem CID 130363602) has the molecular formula C28H34N8O3 and a molecular weight of 530.63 g/mol. Its IUPAC name is 1-[(3R,5S)-4-[3-[4-amino-5-[2-(oxan-4-yl)pyrazol-3-yl]pyrrolo[2,1-f][1,2,4]triazin-7-yl]phenyl]-3,5-dimethylpiperazin-1-yl]-2-hydroxyethanone.
| Compound Name | 1-[(3R,5S)-4-[3-[4-amino-5-[2-(oxan-4-yl)pyrazol-3-yl]pyrrolo[2,1-f][1,2,4]triazin-7-yl]phenyl]-3,5-dimethylpiperazin-1-yl]-2-hydroxyethanone |
|---|---|
| PubChem CID | 130363602 |
| Molecular Formula | C28H34N8O3 |
| Molecular Weight | 530.63 g/mol |
| Exact Mass | 530.28 |
| IUPAC Name | 1-[(3R,5S)-4-[3-[4-amino-5-[2-(oxan-4-yl)pyrazol-3-yl]pyrrolo[2,1-f][1,2,4]triazin-7-yl]phenyl]-3,5-dimethylpiperazin-1-yl]-2-hydroxyethanone |
| SMILES | C[C@@H]1CN(C(=O)CO)C[C@H](C)N1c1cccc(-c2cc(-c3ccnn3C3CCOCC3)c3c(N)ncnn23)c1 |
| InChI | InChI=1S/C28H34N8O3/c1-18-14-33(26(38)16-37)15-19(2)34(18)22-5-3-4-20(12-22)25-13-23(27-28(29)30-17-32-36(25)27)24-6-9-31-35(24)21-7-10-39-11-8-21/h3-6,9,12-13,17-19,21,37H,7-8,10-11,14-16H2,1-2H3,(H2,29,30,32)/t18-,19+ |
| InChIKey | FFAFPYCUEZHRTM-KDURUIRLSA-N |
| XLogP | 2.61 |
| TPSA | 127.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.63 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |