C27H29F3N8O3 — CID 130363664
4-acetyl-1-[5-[4-amino-5-[2-(1,1,1-trifluoropropan-2-yl)pyrazol-3-yl]pyrrolo[2,1-f][1,2,4]triazin-7-yl]-2-methoxyphenyl]-3,3-dimethylpiperazin-2-one (PubChem CID 130363664) has the molecular formula C27H29F3N8O3 and a molecular weight of 570.58 g/mol. Its IUPAC name is 4-acetyl-1-[5-[4-amino-5-[2-(1,1,1-trifluoropropan-2-yl)pyrazol-3-yl]pyrrolo[2,1-f][1,2,4]triazin-7-yl]-2-methoxyphenyl]-3,3-dimethylpiperazin-2-one.
| Compound Name | 4-acetyl-1-[5-[4-amino-5-[2-(1,1,1-trifluoropropan-2-yl)pyrazol-3-yl]pyrrolo[2,1-f][1,2,4]triazin-7-yl]-2-methoxyphenyl]-3,3-dimethylpiperazin-2-one |
|---|---|
| PubChem CID | 130363664 |
| Molecular Formula | C27H29F3N8O3 |
| Molecular Weight | 570.58 g/mol |
| Exact Mass | 570.23 |
| IUPAC Name | 4-acetyl-1-[5-[4-amino-5-[2-(1,1,1-trifluoropropan-2-yl)pyrazol-3-yl]pyrrolo[2,1-f][1,2,4]triazin-7-yl]-2-methoxyphenyl]-3,3-dimethylpiperazin-2-one |
| SMILES | COc1ccc(-c2cc(-c3ccnn3C(C)C(F)(F)F)c3c(N)ncnn23)cc1N1CCN(C(C)=O)C(C)(C)C1=O |
| InChI | InChI=1S/C27H29F3N8O3/c1-15(27(28,29)30)37-19(8-9-33-37)18-13-20(38-23(18)24(31)32-14-34-38)17-6-7-22(41-5)21(12-17)35-10-11-36(16(2)39)26(3,4)25(35)40/h6-9,12-15H,10-11H2,1-5H3,(H2,31,32,34) |
| InChIKey | JKDDXYJQJYTIHT-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 123.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.58 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |