C22H29N7O2 — CID 13036383
2-[4-(1,4,5,6,7,8-hexahydrocyclohepta[d]imidazol-2-yl)piperazin-1-yl]-6,7-dimethoxyquinazolin-4-amine (PubChem CID 13036383) has the molecular formula C22H29N7O2 and a molecular weight of 423.52 g/mol. Its IUPAC name is 2-[4-(1,4,5,6,7,8-hexahydrocyclohepta[d]imidazol-2-yl)piperazin-1-yl]-6,7-dimethoxyquinazolin-4-amine.
| Compound Name | 2-[4-(1,4,5,6,7,8-hexahydrocyclohepta[d]imidazol-2-yl)piperazin-1-yl]-6,7-dimethoxyquinazolin-4-amine |
|---|---|
| PubChem CID | 13036383 |
| Molecular Formula | C22H29N7O2 |
| Molecular Weight | 423.52 g/mol |
| Exact Mass | 423.24 |
| IUPAC Name | 2-[4-(1,4,5,6,7,8-hexahydrocyclohepta[d]imidazol-2-yl)piperazin-1-yl]-6,7-dimethoxyquinazolin-4-amine |
| SMILES | COc1cc2nc(N3CCN(c4nc5c([nH]4)CCCCC5)CC3)nc(N)c2cc1OC |
| InChI | InChI=1S/C22H29N7O2/c1-30-18-12-14-17(13-19(18)31-2)26-22(27-20(14)23)29-10-8-28(9-11-29)21-24-15-6-4-3-5-7-16(15)25-21/h12-13H,3-11H2,1-2H3,(H,24,25)(H2,23,26,27) |
| InChIKey | OCQCJLXCJKKZKW-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 105.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.52 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |