C28H31F3N4O2 — CID 130363872
5-(3,5-dimethyl-1,2-oxazol-4-yl)-N-[4-(trifluoromethoxy)phenyl]-1-[(1R,5R)-3,3,5-trimethylcyclohexyl]benzimidazol-2-amine (PubChem CID 130363872) has the molecular formula C28H31F3N4O2 and a molecular weight of 512.58 g/mol. Its IUPAC name is 5-(3,5-dimethyl-1,2-oxazol-4-yl)-N-[4-(trifluoromethoxy)phenyl]-1-[(1R,5R)-3,3,5-trimethylcyclohexyl]benzimidazol-2-amine.
| Compound Name | 5-(3,5-dimethyl-1,2-oxazol-4-yl)-N-[4-(trifluoromethoxy)phenyl]-1-[(1R,5R)-3,3,5-trimethylcyclohexyl]benzimidazol-2-amine |
|---|---|
| PubChem CID | 130363872 |
| Molecular Formula | C28H31F3N4O2 |
| Molecular Weight | 512.58 g/mol |
| Exact Mass | 512.24 |
| IUPAC Name | 5-(3,5-dimethyl-1,2-oxazol-4-yl)-N-[4-(trifluoromethoxy)phenyl]-1-[(1R,5R)-3,3,5-trimethylcyclohexyl]benzimidazol-2-amine |
| SMILES | Cc1noc(C)c1-c1ccc2c(c1)nc(Nc1ccc(OC(F)(F)F)cc1)n2[C@@H]1C[C@H](C)CC(C)(C)C1 |
| InChI | InChI=1S/C28H31F3N4O2/c1-16-12-21(15-27(4,5)14-16)35-24-11-6-19(25-17(2)34-37-18(25)3)13-23(24)33-26(35)32-20-7-9-22(10-8-20)36-28(29,30)31/h6-11,13,16,21H,12,14-15H2,1-5H3,(H,32,33)/t16-,21+/m0/s1 |
| InChIKey | NDUCHRAKQIXMCH-HRAATJIYSA-N |
| XLogP | 8.34 |
| TPSA | 65.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.58 |
| LogP ≤ 5 | 8.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |