C28H31F3N4O — CID 130363900
5-(3,5-dimethyl-1,2-oxazol-4-yl)-N-[4-(trifluoromethyl)phenyl]-1-[(1R,5R)-3,3,5-trimethylcyclohexyl]benzimidazol-2-amine (PubChem CID 130363900) has the molecular formula C28H31F3N4O and a molecular weight of 496.58 g/mol. Its IUPAC name is 5-(3,5-dimethyl-1,2-oxazol-4-yl)-N-[4-(trifluoromethyl)phenyl]-1-[(1R,5R)-3,3,5-trimethylcyclohexyl]benzimidazol-2-amine.
| Compound Name | 5-(3,5-dimethyl-1,2-oxazol-4-yl)-N-[4-(trifluoromethyl)phenyl]-1-[(1R,5R)-3,3,5-trimethylcyclohexyl]benzimidazol-2-amine |
|---|---|
| PubChem CID | 130363900 |
| Molecular Formula | C28H31F3N4O |
| Molecular Weight | 496.58 g/mol |
| Exact Mass | 496.24 |
| IUPAC Name | 5-(3,5-dimethyl-1,2-oxazol-4-yl)-N-[4-(trifluoromethyl)phenyl]-1-[(1R,5R)-3,3,5-trimethylcyclohexyl]benzimidazol-2-amine |
| SMILES | Cc1noc(C)c1-c1ccc2c(c1)nc(Nc1ccc(C(F)(F)F)cc1)n2[C@@H]1C[C@H](C)CC(C)(C)C1 |
| InChI | InChI=1S/C28H31F3N4O/c1-16-12-22(15-27(4,5)14-16)35-24-11-6-19(25-17(2)34-36-18(25)3)13-23(24)33-26(35)32-21-9-7-20(8-10-21)28(29,30)31/h6-11,13,16,22H,12,14-15H2,1-5H3,(H,32,33)/t16-,22+/m0/s1 |
| InChIKey | YZTSWPDJOHSPBB-KSFYIVLOSA-N |
| XLogP | 8.46 |
| TPSA | 55.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.58 |
| LogP ≤ 5 | 8.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |