About ethyl (Z)-3,5,5-triethoxypent-2-enoate
ethyl (Z)-3,5,5-triethoxypent-2-enoate (PubChem CID 13036395) has the molecular formula C13H24O5
and a molecular weight of 260.33 g/mol. Its IUPAC name is ethyl (Z)-3,5,5-triethoxypent-2-enoate.
Molecular Properties
| Compound Name | ethyl (Z)-3,5,5-triethoxypent-2-enoate |
| PubChem CID | 13036395 |
| Molecular Formula | C13H24O5 |
| Molecular Weight | 260.33 g/mol |
| Exact Mass | 260.16 |
| IUPAC Name | ethyl (Z)-3,5,5-triethoxypent-2-enoate |
| SMILES | CCOC(=O)/C=C(/CC(OCC)OCC)OCC |
| InChI | InChI=1S/C13H24O5/c1-5-15-11(9-12(14)16-6-2)10-13(17-7-3)18-8-4/h9,13H,5-8,10H2,1-4H3/b11-9- |
| InChIKey | HOZMQLDXPHIKJT-LUAWRHEFSA-N |
| XLogP | 2.26 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.33 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze ethyl (Z)-3,5,5-triethoxypent-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (Z)-3,5,5-triethoxypent-2-enoate?
The IUPAC name of ethyl (Z)-3,5,5-triethoxypent-2-enoate (CID 13036395) is ethyl (Z)-3,5,5-triethoxypent-2-enoate.
What is the SMILES notation for ethyl (Z)-3,5,5-triethoxypent-2-enoate?
The canonical SMILES for ethyl (Z)-3,5,5-triethoxypent-2-enoate is CCOC(=O)/C=C(/CC(OCC)OCC)OCC.
What is the InChIKey of ethyl (Z)-3,5,5-triethoxypent-2-enoate?
The InChIKey is HOZMQLDXPHIKJT-LUAWRHEFSA-N. The full InChI is InChI=1S/C13H24O5/c1-5-15-11(9-12(14)16-6-2)10-13(17-7-3)18-8-4/h9,13H,5-8,10H2,1-4H3/b11-9-.
What are the key properties of ethyl (Z)-3,5,5-triethoxypent-2-enoate?
ethyl (Z)-3,5,5-triethoxypent-2-enoate has a molecular weight of 260.33 g/mol, XLogP of 2.26, 10 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (Z)-3,5,5-triethoxypent-2-enoate is sourced from PubChem (CID 13036395), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).