About [5-[[(2R)-2-(methoxymethyl)pyrrolidin-1-yl]methyl]-1,3-thiazol-2-yl] carbamate
[5-[[(2R)-2-(methoxymethyl)pyrrolidin-1-yl]methyl]-1,3-thiazol-2-yl] carbamate (PubChem CID 130364618) has the molecular formula C11H17N3O3S
and a molecular weight of 271.34 g/mol. Its IUPAC name is [5-[[(2R)-2-(methoxymethyl)pyrrolidin-1-yl]methyl]-1,3-thiazol-2-yl] carbamate.
Molecular Properties
| Compound Name | [5-[[(2R)-2-(methoxymethyl)pyrrolidin-1-yl]methyl]-1,3-thiazol-2-yl] carbamate |
| PubChem CID | 130364618 |
| Molecular Formula | C11H17N3O3S |
| Molecular Weight | 271.34 g/mol |
| Exact Mass | 271.10 |
| IUPAC Name | [5-[[(2R)-2-(methoxymethyl)pyrrolidin-1-yl]methyl]-1,3-thiazol-2-yl] carbamate |
| SMILES | COC[C@H]1CCCN1Cc1cnc(OC(N)=O)s1 |
| InChI | InChI=1S/C11H17N3O3S/c1-16-7-8-3-2-4-14(8)6-9-5-13-11(18-9)17-10(12)15/h5,8H,2-4,6-7H2,1H3,(H2,12,15)/t8-/m1/s1 |
| InChIKey | GUWIPLBOJVBCRV-MRVPVSSYSA-N |
| XLogP | 1.21 |
| TPSA | 77.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.34 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [5-[[(2R)-2-(methoxymethyl)pyrrolidin-1-yl]methyl]-1,3-thiazol-2-yl] carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-[[(2R)-2-(methoxymethyl)pyrrolidin-1-yl]methyl]-1,3-thiazol-2-yl] carbamate?
The IUPAC name of [5-[[(2R)-2-(methoxymethyl)pyrrolidin-1-yl]methyl]-1,3-thiazol-2-yl] carbamate (CID 130364618) is [5-[[(2R)-2-(methoxymethyl)pyrrolidin-1-yl]methyl]-1,3-thiazol-2-yl] carbamate.
What is the SMILES notation for [5-[[(2R)-2-(methoxymethyl)pyrrolidin-1-yl]methyl]-1,3-thiazol-2-yl] carbamate?
The canonical SMILES for [5-[[(2R)-2-(methoxymethyl)pyrrolidin-1-yl]methyl]-1,3-thiazol-2-yl] carbamate is COC[C@H]1CCCN1Cc1cnc(OC(N)=O)s1.
What is the InChIKey of [5-[[(2R)-2-(methoxymethyl)pyrrolidin-1-yl]methyl]-1,3-thiazol-2-yl] carbamate?
The InChIKey is GUWIPLBOJVBCRV-MRVPVSSYSA-N. The full InChI is InChI=1S/C11H17N3O3S/c1-16-7-8-3-2-4-14(8)6-9-5-13-11(18-9)17-10(12)15/h5,8H,2-4,6-7H2,1H3,(H2,12,15)/t8-/m1/s1.
What are the key properties of [5-[[(2R)-2-(methoxymethyl)pyrrolidin-1-yl]methyl]-1,3-thiazol-2-yl] carbamate?
[5-[[(2R)-2-(methoxymethyl)pyrrolidin-1-yl]methyl]-1,3-thiazol-2-yl] carbamate has a molecular weight of 271.34 g/mol, XLogP of 1.21, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [5-[[(2R)-2-(methoxymethyl)pyrrolidin-1-yl]methyl]-1,3-thiazol-2-yl] carbamate is sourced from PubChem (CID 130364618), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).