C19H32N10O3S — CID 130365063
3-(ditert-butylamino)-1,4-bis(2H-triazol-4-yl)-2-(2H-triazol-4-ylmethyl)butane-2-sulfonic acid (PubChem CID 130365063) has the molecular formula C19H32N10O3S and a molecular weight of 480.60 g/mol. Its IUPAC name is 3-(ditert-butylamino)-1,4-bis(2H-triazol-4-yl)-2-(2H-triazol-4-ylmethyl)butane-2-sulfonic acid.
| Compound Name | 3-(ditert-butylamino)-1,4-bis(2H-triazol-4-yl)-2-(2H-triazol-4-ylmethyl)butane-2-sulfonic acid |
|---|---|
| PubChem CID | 130365063 |
| Molecular Formula | C19H32N10O3S |
| Molecular Weight | 480.60 g/mol |
| Exact Mass | 480.24 |
| IUPAC Name | 3-(ditert-butylamino)-1,4-bis(2H-triazol-4-yl)-2-(2H-triazol-4-ylmethyl)butane-2-sulfonic acid |
| SMILES | CC(C)(C)N(C(Cc1cn[nH]n1)C(Cc1cn[nH]n1)(Cc1cn[nH]n1)S(=O)(=O)O)C(C)(C)C |
| InChI | InChI=1S/C19H32N10O3S/c1-17(2,3)29(18(4,5)6)16(7-13-10-20-26-23-13)19(33(30,31)32,8-14-11-21-27-24-14)9-15-12-22-28-25-15/h10-12,16H,7-9H2,1-6H3,(H,20,23,26)(H,21,24,27)(H,22,25,28)(H,30,31,32) |
| InChIKey | VENXZLROZBIWPL-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 182.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.60 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|