About 7-[1-(2-methylsulfonylphenyl)ethylsulfanyl]-2H-triazolo[4,5-b]pyridin-5-amine
7-[1-(2-methylsulfonylphenyl)ethylsulfanyl]-2H-triazolo[4,5-b]pyridin-5-amine (PubChem CID 130365263) has the molecular formula C14H15N5O2S2
and a molecular weight of 349.44 g/mol. Its IUPAC name is 7-[1-(2-methylsulfonylphenyl)ethylsulfanyl]-2H-triazolo[4,5-b]pyridin-5-amine.
Molecular Properties
| Compound Name | 7-[1-(2-methylsulfonylphenyl)ethylsulfanyl]-2H-triazolo[4,5-b]pyridin-5-amine |
| PubChem CID | 130365263 |
| Molecular Formula | C14H15N5O2S2 |
| Molecular Weight | 349.44 g/mol |
| Exact Mass | 349.07 |
| IUPAC Name | 7-[1-(2-methylsulfonylphenyl)ethylsulfanyl]-2H-triazolo[4,5-b]pyridin-5-amine |
| SMILES | CC(Sc1cc(N)nc2n[nH]nc12)c1ccccc1S(C)(=O)=O |
| InChI | InChI=1S/C14H15N5O2S2/c1-8(9-5-3-4-6-11(9)23(2,20)21)22-10-7-12(15)16-14-13(10)17-19-18-14/h3-8H,1-2H3,(H3,15,16,17,18,19) |
| InChIKey | ZZHOIDCQXDVNEL-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 114.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.44 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 7-[1-(2-methylsulfonylphenyl)ethylsulfanyl]-2H-triazolo[4,5-b]pyridin-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-[1-(2-methylsulfonylphenyl)ethylsulfanyl]-2H-triazolo[4,5-b]pyridin-5-amine?
The IUPAC name of 7-[1-(2-methylsulfonylphenyl)ethylsulfanyl]-2H-triazolo[4,5-b]pyridin-5-amine (CID 130365263) is 7-[1-(2-methylsulfonylphenyl)ethylsulfanyl]-2H-triazolo[4,5-b]pyridin-5-amine.
What is the SMILES notation for 7-[1-(2-methylsulfonylphenyl)ethylsulfanyl]-2H-triazolo[4,5-b]pyridin-5-amine?
The canonical SMILES for 7-[1-(2-methylsulfonylphenyl)ethylsulfanyl]-2H-triazolo[4,5-b]pyridin-5-amine is CC(Sc1cc(N)nc2n[nH]nc12)c1ccccc1S(C)(=O)=O.
What is the InChIKey of 7-[1-(2-methylsulfonylphenyl)ethylsulfanyl]-2H-triazolo[4,5-b]pyridin-5-amine?
The InChIKey is ZZHOIDCQXDVNEL-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15N5O2S2/c1-8(9-5-3-4-6-11(9)23(2,20)21)22-10-7-12(15)16-14-13(10)17-19-18-14/h3-8H,1-2H3,(H3,15,16,17,18,19).
What are the key properties of 7-[1-(2-methylsulfonylphenyl)ethylsulfanyl]-2H-triazolo[4,5-b]pyridin-5-amine?
7-[1-(2-methylsulfonylphenyl)ethylsulfanyl]-2H-triazolo[4,5-b]pyridin-5-amine has a molecular weight of 349.44 g/mol, XLogP of 2.19, 4 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 7-[1-(2-methylsulfonylphenyl)ethylsulfanyl]-2H-triazolo[4,5-b]pyridin-5-amine is sourced from PubChem (CID 130365263), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).