C7H13Cl2N3 — CID 13036532
4,5,6,7-tetrahydro-1H-indazol-5-amine;dihydrochloride (PubChem CID 13036532) has the molecular formula C7H13Cl2N3 and a molecular weight of 210.11 g/mol. Its IUPAC name is 4,5,6,7-tetrahydro-1H-indazol-5-amine;dihydrochloride.
| Compound Name | 4,5,6,7-tetrahydro-1H-indazol-5-amine;dihydrochloride |
|---|---|
| PubChem CID | 13036532 |
| Molecular Formula | C7H13Cl2N3 |
| Molecular Weight | 210.11 g/mol |
| Exact Mass | 209.05 |
| IUPAC Name | 4,5,6,7-tetrahydro-1H-indazol-5-amine;dihydrochloride |
| SMILES | Cl.Cl.NC1CCc2[nH]ncc2C1 |
| InChI | InChI=1S/C7H11N3.2ClH/c8-6-1-2-7-5(3-6)4-9-10-7;;/h4,6H,1-3,8H2,(H,9,10);2*1H |
| InChIKey | IHDUZMHOIVQJGL-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.11 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |