About 2-imidazol-1-yl-N,N-bis(prop-2-enyl)acetamide
2-imidazol-1-yl-N,N-bis(prop-2-enyl)acetamide (PubChem CID 13036586) has the molecular formula C11H15N3O
and a molecular weight of 205.26 g/mol. Its IUPAC name is 2-imidazol-1-yl-N,N-bis(prop-2-enyl)acetamide.
Molecular Properties
| Compound Name | 2-imidazol-1-yl-N,N-bis(prop-2-enyl)acetamide |
| PubChem CID | 13036586 |
| Molecular Formula | C11H15N3O |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.12 |
| IUPAC Name | 2-imidazol-1-yl-N,N-bis(prop-2-enyl)acetamide |
| SMILES | C=CCN(CC=C)C(=O)Cn1ccnc1 |
| InChI | InChI=1S/C11H15N3O/c1-3-6-14(7-4-2)11(15)9-13-8-5-12-10-13/h3-5,8,10H,1-2,6-7,9H2 |
| InChIKey | HTIUVVYUWNVFAN-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-imidazol-1-yl-N,N-bis(prop-2-enyl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-imidazol-1-yl-N,N-bis(prop-2-enyl)acetamide?
The IUPAC name of 2-imidazol-1-yl-N,N-bis(prop-2-enyl)acetamide (CID 13036586) is 2-imidazol-1-yl-N,N-bis(prop-2-enyl)acetamide.
What is the SMILES notation for 2-imidazol-1-yl-N,N-bis(prop-2-enyl)acetamide?
The canonical SMILES for 2-imidazol-1-yl-N,N-bis(prop-2-enyl)acetamide is C=CCN(CC=C)C(=O)Cn1ccnc1.
What is the InChIKey of 2-imidazol-1-yl-N,N-bis(prop-2-enyl)acetamide?
The InChIKey is HTIUVVYUWNVFAN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15N3O/c1-3-6-14(7-4-2)11(15)9-13-8-5-12-10-13/h3-5,8,10H,1-2,6-7,9H2.
What are the key properties of 2-imidazol-1-yl-N,N-bis(prop-2-enyl)acetamide?
2-imidazol-1-yl-N,N-bis(prop-2-enyl)acetamide has a molecular weight of 205.26 g/mol, XLogP of 1.08, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-imidazol-1-yl-N,N-bis(prop-2-enyl)acetamide is sourced from PubChem (CID 13036586), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).