About N,N-di(propan-2-yl)-2-(1,2,4-triazol-1-yl)acetamide
N,N-di(propan-2-yl)-2-(1,2,4-triazol-1-yl)acetamide (PubChem CID 13036589) has the molecular formula C10H18N4O
and a molecular weight of 210.28 g/mol. Its IUPAC name is N,N-di(propan-2-yl)-2-(1,2,4-triazol-1-yl)acetamide.
Molecular Properties
| Compound Name | N,N-di(propan-2-yl)-2-(1,2,4-triazol-1-yl)acetamide |
| PubChem CID | 13036589 |
| Molecular Formula | C10H18N4O |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.15 |
| IUPAC Name | N,N-di(propan-2-yl)-2-(1,2,4-triazol-1-yl)acetamide |
| SMILES | CC(C)N(C(=O)Cn1cncn1)C(C)C |
| InChI | InChI=1S/C10H18N4O/c1-8(2)14(9(3)4)10(15)5-13-7-11-6-12-13/h6-9H,5H2,1-4H3 |
| InChIKey | MHADFMSGBSQRQH-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N,N-di(propan-2-yl)-2-(1,2,4-triazol-1-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-di(propan-2-yl)-2-(1,2,4-triazol-1-yl)acetamide?
The IUPAC name of N,N-di(propan-2-yl)-2-(1,2,4-triazol-1-yl)acetamide (CID 13036589) is N,N-di(propan-2-yl)-2-(1,2,4-triazol-1-yl)acetamide.
What is the SMILES notation for N,N-di(propan-2-yl)-2-(1,2,4-triazol-1-yl)acetamide?
The canonical SMILES for N,N-di(propan-2-yl)-2-(1,2,4-triazol-1-yl)acetamide is CC(C)N(C(=O)Cn1cncn1)C(C)C.
What is the InChIKey of N,N-di(propan-2-yl)-2-(1,2,4-triazol-1-yl)acetamide?
The InChIKey is MHADFMSGBSQRQH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18N4O/c1-8(2)14(9(3)4)10(15)5-13-7-11-6-12-13/h6-9H,5H2,1-4H3.
What are the key properties of N,N-di(propan-2-yl)-2-(1,2,4-triazol-1-yl)acetamide?
N,N-di(propan-2-yl)-2-(1,2,4-triazol-1-yl)acetamide has a molecular weight of 210.28 g/mol, XLogP of 0.92, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-di(propan-2-yl)-2-(1,2,4-triazol-1-yl)acetamide is sourced from PubChem (CID 13036589), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).