C10H7Cl2N7O — CID 130365922
7-[(2,6-dichloro-4-pyridinyl)methoxy]-2H-triazolo[4,5-d]pyrimidin-5-amine (PubChem CID 130365922) has the molecular formula C10H7Cl2N7O and a molecular weight of 312.12 g/mol. Its IUPAC name is 7-[(2,6-dichloro-4-pyridinyl)methoxy]-2H-triazolo[4,5-d]pyrimidin-5-amine.
| Compound Name | 7-[(2,6-dichloro-4-pyridinyl)methoxy]-2H-triazolo[4,5-d]pyrimidin-5-amine |
|---|---|
| PubChem CID | 130365922 |
| Molecular Formula | C10H7Cl2N7O |
| Molecular Weight | 312.12 g/mol |
| Exact Mass | 311.01 |
| IUPAC Name | 7-[(2,6-dichloro-4-pyridinyl)methoxy]-2H-triazolo[4,5-d]pyrimidin-5-amine |
| SMILES | Nc1nc(OCc2cc(Cl)nc(Cl)c2)c2n[nH]nc2n1 |
| InChI | InChI=1S/C10H7Cl2N7O/c11-5-1-4(2-6(12)14-5)3-20-9-7-8(18-19-17-7)15-10(13)16-9/h1-2H,3H2,(H3,13,15,16,17,18,19) |
| InChIKey | ZQDCMCQZBIUPHV-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 115.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.12 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|