About N,N-diethyl-2-(1,2,4-triazol-1-yl)propanamide
N,N-diethyl-2-(1,2,4-triazol-1-yl)propanamide (PubChem CID 13036598) has the molecular formula C9H16N4O
and a molecular weight of 196.25 g/mol. Its IUPAC name is N,N-diethyl-2-(1,2,4-triazol-1-yl)propanamide.
Molecular Properties
| Compound Name | N,N-diethyl-2-(1,2,4-triazol-1-yl)propanamide |
| PubChem CID | 13036598 |
| Molecular Formula | C9H16N4O |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.13 |
| IUPAC Name | N,N-diethyl-2-(1,2,4-triazol-1-yl)propanamide |
| SMILES | CCN(CC)C(=O)C(C)n1cncn1 |
| InChI | InChI=1S/C9H16N4O/c1-4-12(5-2)9(14)8(3)13-7-10-6-11-13/h6-8H,4-5H2,1-3H3 |
| InChIKey | WEMQLFYUDFKUIA-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N,N-diethyl-2-(1,2,4-triazol-1-yl)propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-diethyl-2-(1,2,4-triazol-1-yl)propanamide?
The IUPAC name of N,N-diethyl-2-(1,2,4-triazol-1-yl)propanamide (CID 13036598) is N,N-diethyl-2-(1,2,4-triazol-1-yl)propanamide.
What is the SMILES notation for N,N-diethyl-2-(1,2,4-triazol-1-yl)propanamide?
The canonical SMILES for N,N-diethyl-2-(1,2,4-triazol-1-yl)propanamide is CCN(CC)C(=O)C(C)n1cncn1.
What is the InChIKey of N,N-diethyl-2-(1,2,4-triazol-1-yl)propanamide?
The InChIKey is WEMQLFYUDFKUIA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16N4O/c1-4-12(5-2)9(14)8(3)13-7-10-6-11-13/h6-8H,4-5H2,1-3H3.
What are the key properties of N,N-diethyl-2-(1,2,4-triazol-1-yl)propanamide?
N,N-diethyl-2-(1,2,4-triazol-1-yl)propanamide has a molecular weight of 196.25 g/mol, XLogP of 0.71, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-diethyl-2-(1,2,4-triazol-1-yl)propanamide is sourced from PubChem (CID 13036598), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).