About 2-acetyl-2-nitrohexanoic acid
2-acetyl-2-nitrohexanoic acid (PubChem CID 130366242) has the molecular formula C8H13NO5
and a molecular weight of 203.19 g/mol. Its IUPAC name is 2-acetyl-2-nitrohexanoic acid.
Molecular Properties
| Compound Name | 2-acetyl-2-nitrohexanoic acid |
| PubChem CID | 130366242 |
| Molecular Formula | C8H13NO5 |
| Molecular Weight | 203.19 g/mol |
| Exact Mass | 203.08 |
| IUPAC Name | 2-acetyl-2-nitrohexanoic acid |
| SMILES | CCCCC(C(C)=O)(C(=O)O)[N+](=O)[O-] |
| InChI | InChI=1S/C8H13NO5/c1-3-4-5-8(6(2)10,7(11)12)9(13)14/h3-5H2,1-2H3,(H,11,12) |
| InChIKey | IFIQKJCYUWOYMT-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 97.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.19 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-acetyl-2-nitrohexanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-acetyl-2-nitrohexanoic acid?
The IUPAC name of 2-acetyl-2-nitrohexanoic acid (CID 130366242) is 2-acetyl-2-nitrohexanoic acid.
What is the SMILES notation for 2-acetyl-2-nitrohexanoic acid?
The canonical SMILES for 2-acetyl-2-nitrohexanoic acid is CCCCC(C(C)=O)(C(=O)O)[N+](=O)[O-].
What is the InChIKey of 2-acetyl-2-nitrohexanoic acid?
The InChIKey is IFIQKJCYUWOYMT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13NO5/c1-3-4-5-8(6(2)10,7(11)12)9(13)14/h3-5H2,1-2H3,(H,11,12).
What are the key properties of 2-acetyl-2-nitrohexanoic acid?
2-acetyl-2-nitrohexanoic acid has a molecular weight of 203.19 g/mol, XLogP of 0.87, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-acetyl-2-nitrohexanoic acid is sourced from PubChem (CID 130366242), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).