C15H15F13N2O3S2 — CID 130366349
3-[3-methyl-2-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctylsulfanyl)imidazol-3-ium-1-yl]propane-1-sulfonate (PubChem CID 130366349) has the molecular formula C15H15F13N2O3S2 and a molecular weight of 582.40 g/mol. Its IUPAC name is 3-[3-methyl-2-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctylsulfanyl)imidazol-3-ium-1-yl]propane-1-sulfonate.
| Compound Name | 3-[3-methyl-2-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctylsulfanyl)imidazol-3-ium-1-yl]propane-1-sulfonate |
|---|---|
| PubChem CID | 130366349 |
| Molecular Formula | C15H15F13N2O3S2 |
| Molecular Weight | 582.40 g/mol |
| Exact Mass | 582.03 |
| IUPAC Name | 3-[3-methyl-2-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctylsulfanyl)imidazol-3-ium-1-yl]propane-1-sulfonate |
| SMILES | C[n+]1ccn(CCCS(=O)(=O)[O-])c1SCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C15H15F13N2O3S2/c1-29-5-6-30(4-2-8-35(31,32)33)9(29)34-7-3-10(16,17)11(18,19)12(20,21)13(22,23)14(24,25)15(26,27)28/h5-6H,2-4,7-8H2,1H3 |
| InChIKey | PQTQEOUWWIUFGT-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 66.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.40 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|