About 6-piperazin-1-yl-2,3-dihydroisoindol-1-one
6-piperazin-1-yl-2,3-dihydroisoindol-1-one (PubChem CID 130366423) has the molecular formula C12H15N3O
and a molecular weight of 217.27 g/mol. Its IUPAC name is 6-piperazin-1-yl-2,3-dihydroisoindol-1-one.
Molecular Properties
| Compound Name | 6-piperazin-1-yl-2,3-dihydroisoindol-1-one |
| PubChem CID | 130366423 |
| Molecular Formula | C12H15N3O |
| Molecular Weight | 217.27 g/mol |
| Exact Mass | 217.12 |
| IUPAC Name | 6-piperazin-1-yl-2,3-dihydroisoindol-1-one |
| SMILES | O=C1NCc2ccc(N3CCNCC3)cc21 |
| InChI | InChI=1S/C12H15N3O/c16-12-11-7-10(2-1-9(11)8-14-12)15-5-3-13-4-6-15/h1-2,7,13H,3-6,8H2,(H,14,16) |
| InChIKey | BSJOQZQRIVTRDP-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.27 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-piperazin-1-yl-2,3-dihydroisoindol-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-piperazin-1-yl-2,3-dihydroisoindol-1-one?
The IUPAC name of 6-piperazin-1-yl-2,3-dihydroisoindol-1-one (CID 130366423) is 6-piperazin-1-yl-2,3-dihydroisoindol-1-one.
What is the SMILES notation for 6-piperazin-1-yl-2,3-dihydroisoindol-1-one?
The canonical SMILES for 6-piperazin-1-yl-2,3-dihydroisoindol-1-one is O=C1NCc2ccc(N3CCNCC3)cc21.
What is the InChIKey of 6-piperazin-1-yl-2,3-dihydroisoindol-1-one?
The InChIKey is BSJOQZQRIVTRDP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15N3O/c16-12-11-7-10(2-1-9(11)8-14-12)15-5-3-13-4-6-15/h1-2,7,13H,3-6,8H2,(H,14,16).
What are the key properties of 6-piperazin-1-yl-2,3-dihydroisoindol-1-one?
6-piperazin-1-yl-2,3-dihydroisoindol-1-one has a molecular weight of 217.27 g/mol, XLogP of 0.34, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-piperazin-1-yl-2,3-dihydroisoindol-1-one is sourced from PubChem (CID 130366423), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).