About 3-[2-[4-[1-(2,3-dihydro-1-benzofuran-6-yl)ethyl]piperazin-1-yl]pyrimidin-5-yl]oxetan-3-ol
3-[2-[4-[1-(2,3-dihydro-1-benzofuran-6-yl)ethyl]piperazin-1-yl]pyrimidin-5-yl]oxetan-3-ol (PubChem CID 130366453) has the molecular formula C21H26N4O3
and a molecular weight of 382.46 g/mol. Its IUPAC name is 3-[2-[4-[1-(2,3-dihydro-1-benzofuran-6-yl)ethyl]piperazin-1-yl]pyrimidin-5-yl]oxetan-3-ol.
Molecular Properties
| Compound Name | 3-[2-[4-[1-(2,3-dihydro-1-benzofuran-6-yl)ethyl]piperazin-1-yl]pyrimidin-5-yl]oxetan-3-ol |
| PubChem CID | 130366453 |
| Molecular Formula | C21H26N4O3 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.20 |
| IUPAC Name | 3-[2-[4-[1-(2,3-dihydro-1-benzofuran-6-yl)ethyl]piperazin-1-yl]pyrimidin-5-yl]oxetan-3-ol |
| SMILES | CC(c1ccc2c(c1)OCC2)N1CCN(c2ncc(C3(O)COC3)cn2)CC1 |
| InChI | InChI=1S/C21H26N4O3/c1-15(17-3-2-16-4-9-28-19(16)10-17)24-5-7-25(8-6-24)20-22-11-18(12-23-20)21(26)13-27-14-21/h2-3,10-12,15,26H,4-9,13-14H2,1H3 |
| InChIKey | GGSVBFAMUSTMEB-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 70.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 3-[2-[4-[1-(2,3-dihydro-1-benzofuran-6-yl)ethyl]piperazin-1-yl]pyrimidin-5-yl]oxetan-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-[4-[1-(2,3-dihydro-1-benzofuran-6-yl)ethyl]piperazin-1-yl]pyrimidin-5-yl]oxetan-3-ol?
The IUPAC name of 3-[2-[4-[1-(2,3-dihydro-1-benzofuran-6-yl)ethyl]piperazin-1-yl]pyrimidin-5-yl]oxetan-3-ol (CID 130366453) is 3-[2-[4-[1-(2,3-dihydro-1-benzofuran-6-yl)ethyl]piperazin-1-yl]pyrimidin-5-yl]oxetan-3-ol.
What is the SMILES notation for 3-[2-[4-[1-(2,3-dihydro-1-benzofuran-6-yl)ethyl]piperazin-1-yl]pyrimidin-5-yl]oxetan-3-ol?
The canonical SMILES for 3-[2-[4-[1-(2,3-dihydro-1-benzofuran-6-yl)ethyl]piperazin-1-yl]pyrimidin-5-yl]oxetan-3-ol is CC(c1ccc2c(c1)OCC2)N1CCN(c2ncc(C3(O)COC3)cn2)CC1.
What is the InChIKey of 3-[2-[4-[1-(2,3-dihydro-1-benzofuran-6-yl)ethyl]piperazin-1-yl]pyrimidin-5-yl]oxetan-3-ol?
The InChIKey is GGSVBFAMUSTMEB-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H26N4O3/c1-15(17-3-2-16-4-9-28-19(16)10-17)24-5-7-25(8-6-24)20-22-11-18(12-23-20)21(26)13-27-14-21/h2-3,10-12,15,26H,4-9,13-14H2,1H3.
What are the key properties of 3-[2-[4-[1-(2,3-dihydro-1-benzofuran-6-yl)ethyl]piperazin-1-yl]pyrimidin-5-yl]oxetan-3-ol?
3-[2-[4-[1-(2,3-dihydro-1-benzofuran-6-yl)ethyl]piperazin-1-yl]pyrimidin-5-yl]oxetan-3-ol has a molecular weight of 382.46 g/mol, XLogP of 1.51, 4 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-[4-[1-(2,3-dihydro-1-benzofuran-6-yl)ethyl]piperazin-1-yl]pyrimidin-5-yl]oxetan-3-ol is sourced from PubChem (CID 130366453), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).