C26H34N4O3 — CID 130366604
7,8-dimethoxy-N,2-dimethyl-5-[4-(4-methylpiperazin-1-yl)phenyl]-1,2-dihydro-3-benzazepine-3-carboxamide (PubChem CID 130366604) has the molecular formula C26H34N4O3 and a molecular weight of 450.58 g/mol. Its IUPAC name is 7,8-dimethoxy-N,2-dimethyl-5-[4-(4-methylpiperazin-1-yl)phenyl]-1,2-dihydro-3-benzazepine-3-carboxamide.
| Compound Name | 7,8-dimethoxy-N,2-dimethyl-5-[4-(4-methylpiperazin-1-yl)phenyl]-1,2-dihydro-3-benzazepine-3-carboxamide |
|---|---|
| PubChem CID | 130366604 |
| Molecular Formula | C26H34N4O3 |
| Molecular Weight | 450.58 g/mol |
| Exact Mass | 450.26 |
| IUPAC Name | 7,8-dimethoxy-N,2-dimethyl-5-[4-(4-methylpiperazin-1-yl)phenyl]-1,2-dihydro-3-benzazepine-3-carboxamide |
| SMILES | CNC(=O)N1C=C(c2ccc(N3CCN(C)CC3)cc2)c2cc(OC)c(OC)cc2CC1C |
| InChI | InChI=1S/C26H34N4O3/c1-18-14-20-15-24(32-4)25(33-5)16-22(20)23(17-30(18)26(31)27-2)19-6-8-21(9-7-19)29-12-10-28(3)11-13-29/h6-9,15-18H,10-14H2,1-5H3,(H,27,31) |
| InChIKey | ODWOPSFGJIKFRX-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 57.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.58 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'} |
|---|