C15H17FN2O3 — CID 13036729
2,2-diethyl-6-fluorospiro[3H-chromene-4,5'-imidazolidine]-2',4'-dione (PubChem CID 13036729) has the molecular formula C15H17FN2O3 and a molecular weight of 292.31 g/mol. Its IUPAC name is 2,2-diethyl-6-fluorospiro[3H-chromene-4,5'-imidazolidine]-2',4'-dione.
| Compound Name | 2,2-diethyl-6-fluorospiro[3H-chromene-4,5'-imidazolidine]-2',4'-dione |
|---|---|
| PubChem CID | 13036729 |
| Molecular Formula | C15H17FN2O3 |
| Molecular Weight | 292.31 g/mol |
| Exact Mass | 292.12 |
| IUPAC Name | 2,2-diethyl-6-fluorospiro[3H-chromene-4,5'-imidazolidine]-2',4'-dione |
| SMILES | CCC1(CC)CC2(NC(=O)NC2=O)c2cc(F)ccc2O1 |
| InChI | InChI=1S/C15H17FN2O3/c1-3-14(4-2)8-15(12(19)17-13(20)18-15)10-7-9(16)5-6-11(10)21-14/h5-7H,3-4,8H2,1-2H3,(H2,17,18,19,20) |
| InChIKey | DSSSUYIMWDSVDA-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.31 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|