C13H14N2O4 — CID 13036737
6-methoxy-2-methylspiro[2,3-dihydrochromene-4,5'-imidazolidine]-2',4'-dione (PubChem CID 13036737) has the molecular formula C13H14N2O4 and a molecular weight of 262.26 g/mol. Its IUPAC name is 6-methoxy-2-methylspiro[2,3-dihydrochromene-4,5'-imidazolidine]-2',4'-dione.
| Compound Name | 6-methoxy-2-methylspiro[2,3-dihydrochromene-4,5'-imidazolidine]-2',4'-dione |
|---|---|
| PubChem CID | 13036737 |
| Molecular Formula | C13H14N2O4 |
| Molecular Weight | 262.26 g/mol |
| Exact Mass | 262.10 |
| IUPAC Name | 6-methoxy-2-methylspiro[2,3-dihydrochromene-4,5'-imidazolidine]-2',4'-dione |
| SMILES | COc1ccc2c(c1)C1(CC(C)O2)NC(=O)NC1=O |
| InChI | InChI=1S/C13H14N2O4/c1-7-6-13(11(16)14-12(17)15-13)9-5-8(18-2)3-4-10(9)19-7/h3-5,7H,6H2,1-2H3,(H2,14,15,16,17) |
| InChIKey | AQKYCTDXUNAVDI-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.26 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|