About 2-[(3S,5R)-3-methoxy-5-methylhept-6-en-3-yl]sulfanylpyrimidine
2-[(3S,5R)-3-methoxy-5-methylhept-6-en-3-yl]sulfanylpyrimidine (PubChem CID 130367532) has the molecular formula C13H20N2OS
and a molecular weight of 252.38 g/mol. Its IUPAC name is 2-[(3S,5R)-3-methoxy-5-methylhept-6-en-3-yl]sulfanylpyrimidine.
Molecular Properties
| Compound Name | 2-[(3S,5R)-3-methoxy-5-methylhept-6-en-3-yl]sulfanylpyrimidine |
| PubChem CID | 130367532 |
| Molecular Formula | C13H20N2OS |
| Molecular Weight | 252.38 g/mol |
| Exact Mass | 252.13 |
| IUPAC Name | 2-[(3S,5R)-3-methoxy-5-methylhept-6-en-3-yl]sulfanylpyrimidine |
| SMILES | C=C[C@H](C)C[C@@](CC)(OC)Sc1ncccn1 |
| InChI | InChI=1S/C13H20N2OS/c1-5-11(3)10-13(6-2,16-4)17-12-14-8-7-9-15-12/h5,7-9,11H,1,6,10H2,2-4H3/t11-,13-/m0/s1 |
| InChIKey | MQVATJAPIXJROE-AAEUAGOBSA-N |
| XLogP | 3.53 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.38 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-[(3S,5R)-3-methoxy-5-methylhept-6-en-3-yl]sulfanylpyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(3S,5R)-3-methoxy-5-methylhept-6-en-3-yl]sulfanylpyrimidine?
The IUPAC name of 2-[(3S,5R)-3-methoxy-5-methylhept-6-en-3-yl]sulfanylpyrimidine (CID 130367532) is 2-[(3S,5R)-3-methoxy-5-methylhept-6-en-3-yl]sulfanylpyrimidine.
What is the SMILES notation for 2-[(3S,5R)-3-methoxy-5-methylhept-6-en-3-yl]sulfanylpyrimidine?
The canonical SMILES for 2-[(3S,5R)-3-methoxy-5-methylhept-6-en-3-yl]sulfanylpyrimidine is C=C[C@H](C)C[C@@](CC)(OC)Sc1ncccn1.
What is the InChIKey of 2-[(3S,5R)-3-methoxy-5-methylhept-6-en-3-yl]sulfanylpyrimidine?
The InChIKey is MQVATJAPIXJROE-AAEUAGOBSA-N. The full InChI is InChI=1S/C13H20N2OS/c1-5-11(3)10-13(6-2,16-4)17-12-14-8-7-9-15-12/h5,7-9,11H,1,6,10H2,2-4H3/t11-,13-/m0/s1.
What are the key properties of 2-[(3S,5R)-3-methoxy-5-methylhept-6-en-3-yl]sulfanylpyrimidine?
2-[(3S,5R)-3-methoxy-5-methylhept-6-en-3-yl]sulfanylpyrimidine has a molecular weight of 252.38 g/mol, XLogP of 3.53, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(3S,5R)-3-methoxy-5-methylhept-6-en-3-yl]sulfanylpyrimidine is sourced from PubChem (CID 130367532), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).