About 2-[(1R,3R)-3-ethenylcyclohexyl]sulfanylpyrimidine
2-[(1R,3R)-3-ethenylcyclohexyl]sulfanylpyrimidine (PubChem CID 130367631) has the molecular formula C12H16N2S
and a molecular weight of 220.34 g/mol. Its IUPAC name is 2-[(1R,3R)-3-ethenylcyclohexyl]sulfanylpyrimidine.
Molecular Properties
| Compound Name | 2-[(1R,3R)-3-ethenylcyclohexyl]sulfanylpyrimidine |
| PubChem CID | 130367631 |
| Molecular Formula | C12H16N2S |
| Molecular Weight | 220.34 g/mol |
| Exact Mass | 220.10 |
| IUPAC Name | 2-[(1R,3R)-3-ethenylcyclohexyl]sulfanylpyrimidine |
| SMILES | C=C[C@@H]1CCC[C@@H](Sc2ncccn2)C1 |
| InChI | InChI=1S/C12H16N2S/c1-2-10-5-3-6-11(9-10)15-12-13-7-4-8-14-12/h2,4,7-8,10-11H,1,3,5-6,9H2/t10-,11-/m1/s1 |
| InChIKey | JAQHHWPZEAPGTR-GHMZBOCLSA-N |
| XLogP | 3.31 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.34 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-[(1R,3R)-3-ethenylcyclohexyl]sulfanylpyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(1R,3R)-3-ethenylcyclohexyl]sulfanylpyrimidine?
The IUPAC name of 2-[(1R,3R)-3-ethenylcyclohexyl]sulfanylpyrimidine (CID 130367631) is 2-[(1R,3R)-3-ethenylcyclohexyl]sulfanylpyrimidine.
What is the SMILES notation for 2-[(1R,3R)-3-ethenylcyclohexyl]sulfanylpyrimidine?
The canonical SMILES for 2-[(1R,3R)-3-ethenylcyclohexyl]sulfanylpyrimidine is C=C[C@@H]1CCC[C@@H](Sc2ncccn2)C1.
What is the InChIKey of 2-[(1R,3R)-3-ethenylcyclohexyl]sulfanylpyrimidine?
The InChIKey is JAQHHWPZEAPGTR-GHMZBOCLSA-N. The full InChI is InChI=1S/C12H16N2S/c1-2-10-5-3-6-11(9-10)15-12-13-7-4-8-14-12/h2,4,7-8,10-11H,1,3,5-6,9H2/t10-,11-/m1/s1.
What are the key properties of 2-[(1R,3R)-3-ethenylcyclohexyl]sulfanylpyrimidine?
2-[(1R,3R)-3-ethenylcyclohexyl]sulfanylpyrimidine has a molecular weight of 220.34 g/mol, XLogP of 3.31, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(1R,3R)-3-ethenylcyclohexyl]sulfanylpyrimidine is sourced from PubChem (CID 130367631), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).