C12H16N2S — CID 130367632
2-[(1S,3S)-3-ethenylcyclohexyl]sulfanylpyrimidine (PubChem CID 130367632) has the molecular formula C12H16N2S and a molecular weight of 220.34 g/mol. Its IUPAC name is 2-[(1S,3S)-3-ethenylcyclohexyl]sulfanylpyrimidine.
| Compound Name | 2-[(1S,3S)-3-ethenylcyclohexyl]sulfanylpyrimidine |
|---|---|
| PubChem CID | 130367632 |
| Molecular Formula | C12H16N2S |
| Molecular Weight | 220.34 g/mol |
| Exact Mass | 220.10 |
| IUPAC Name | 2-[(1S,3S)-3-ethenylcyclohexyl]sulfanylpyrimidine |
| SMILES | C=C[C@H]1CCC[C@H](Sc2ncccn2)C1 |
| InChI | InChI=1S/C12H16N2S/c1-2-10-5-3-6-11(9-10)15-12-13-7-4-8-14-12/h2,4,7-8,10-11H,1,3,5-6,9H2/t10-,11-/m0/s1 |
| InChIKey | JAQHHWPZEAPGTR-QWRGUYRKSA-N |
| XLogP | 3.31 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.34 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|