About (3S)-5-N-[4-phenyl-2-(2-phenylethyl)butyl]pentane-1,3,5-triamine
(3S)-5-N-[4-phenyl-2-(2-phenylethyl)butyl]pentane-1,3,5-triamine (PubChem CID 130367923) has the molecular formula C23H35N3
and a molecular weight of 353.55 g/mol. Its IUPAC name is (3S)-5-N-[4-phenyl-2-(2-phenylethyl)butyl]pentane-1,3,5-triamine.
Molecular Properties
| Compound Name | (3S)-5-N-[4-phenyl-2-(2-phenylethyl)butyl]pentane-1,3,5-triamine |
| PubChem CID | 130367923 |
| Molecular Formula | C23H35N3 |
| Molecular Weight | 353.55 g/mol |
| Exact Mass | 353.28 |
| IUPAC Name | (3S)-5-N-[4-phenyl-2-(2-phenylethyl)butyl]pentane-1,3,5-triamine |
| SMILES | NCC[C@H](N)CCNCC(CCc1ccccc1)CCc1ccccc1 |
| InChI | InChI=1S/C23H35N3/c24-17-15-23(25)16-18-26-19-22(13-11-20-7-3-1-4-8-20)14-12-21-9-5-2-6-10-21/h1-10,22-23,26H,11-19,24-25H2/t23-/m0/s1 |
| InChIKey | PNGQZFVKUXXCOD-QHCPKHFHSA-N |
| XLogP | 3.52 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 353.55 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (3S)-5-N-[4-phenyl-2-(2-phenylethyl)butyl]pentane-1,3,5-triamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-5-N-[4-phenyl-2-(2-phenylethyl)butyl]pentane-1,3,5-triamine?
The IUPAC name of (3S)-5-N-[4-phenyl-2-(2-phenylethyl)butyl]pentane-1,3,5-triamine (CID 130367923) is (3S)-5-N-[4-phenyl-2-(2-phenylethyl)butyl]pentane-1,3,5-triamine.
What is the SMILES notation for (3S)-5-N-[4-phenyl-2-(2-phenylethyl)butyl]pentane-1,3,5-triamine?
The canonical SMILES for (3S)-5-N-[4-phenyl-2-(2-phenylethyl)butyl]pentane-1,3,5-triamine is NCC[C@H](N)CCNCC(CCc1ccccc1)CCc1ccccc1.
What is the InChIKey of (3S)-5-N-[4-phenyl-2-(2-phenylethyl)butyl]pentane-1,3,5-triamine?
The InChIKey is PNGQZFVKUXXCOD-QHCPKHFHSA-N. The full InChI is InChI=1S/C23H35N3/c24-17-15-23(25)16-18-26-19-22(13-11-20-7-3-1-4-8-20)14-12-21-9-5-2-6-10-21/h1-10,22-23,26H,11-19,24-25H2/t23-/m0/s1.
What are the key properties of (3S)-5-N-[4-phenyl-2-(2-phenylethyl)butyl]pentane-1,3,5-triamine?
(3S)-5-N-[4-phenyl-2-(2-phenylethyl)butyl]pentane-1,3,5-triamine has a molecular weight of 353.55 g/mol, XLogP of 3.52, 13 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-5-N-[4-phenyl-2-(2-phenylethyl)butyl]pentane-1,3,5-triamine is sourced from PubChem (CID 130367923), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).