C28H37N5O3S — CID 130368141
N-[(4-ethylsulfonylphenyl)methyl]-2-(1,3,5-trimethylpyrazol-4-yl)-7,8,9,10,11,12-hexahydro-6H-pyrido[3,2-b]azecine-5-carboxamide (PubChem CID 130368141) has the molecular formula C28H37N5O3S and a molecular weight of 523.70 g/mol. Its IUPAC name is N-[(4-ethylsulfonylphenyl)methyl]-2-(1,3,5-trimethylpyrazol-4-yl)-7,8,9,10,11,12-hexahydro-6H-pyrido[3,2-b]azecine-5-carboxamide.
| Compound Name | N-[(4-ethylsulfonylphenyl)methyl]-2-(1,3,5-trimethylpyrazol-4-yl)-7,8,9,10,11,12-hexahydro-6H-pyrido[3,2-b]azecine-5-carboxamide |
|---|---|
| PubChem CID | 130368141 |
| Molecular Formula | C28H37N5O3S |
| Molecular Weight | 523.70 g/mol |
| Exact Mass | 523.26 |
| IUPAC Name | N-[(4-ethylsulfonylphenyl)methyl]-2-(1,3,5-trimethylpyrazol-4-yl)-7,8,9,10,11,12-hexahydro-6H-pyrido[3,2-b]azecine-5-carboxamide |
| SMILES | CCS(=O)(=O)c1ccc(CNC(=O)N2CCCCCCCc3nc(-c4c(C)nn(C)c4C)ccc32)cc1 |
| InChI | InChI=1S/C28H37N5O3S/c1-5-37(35,36)23-14-12-22(13-15-23)19-29-28(34)33-18-10-8-6-7-9-11-24-26(33)17-16-25(30-24)27-20(2)31-32(4)21(27)3/h12-17H,5-11,18-19H2,1-4H3,(H,29,34) |
| InChIKey | AAOQGAJEGSFZLT-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 97.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.70 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |