About 5-propan-2-yl-1-azacyclohepta-2,4,6,7-tetraen-2-amine
5-propan-2-yl-1-azacyclohepta-2,4,6,7-tetraen-2-amine (PubChem CID 130368208) has the molecular formula C9H12N2
and a molecular weight of 148.21 g/mol. Its IUPAC name is 5-propan-2-yl-1-azacyclohepta-2,4,6,7-tetraen-2-amine.
Analyze 5-propan-2-yl-1-azacyclohepta-2,4,6,7-tetraen-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-propan-2-yl-1-azacyclohepta-2,4,6,7-tetraen-2-amine?
The IUPAC name of 5-propan-2-yl-1-azacyclohepta-2,4,6,7-tetraen-2-amine (CID 130368208) is 5-propan-2-yl-1-azacyclohepta-2,4,6,7-tetraen-2-amine.
What is the SMILES notation for 5-propan-2-yl-1-azacyclohepta-2,4,6,7-tetraen-2-amine?
The canonical SMILES for 5-propan-2-yl-1-azacyclohepta-2,4,6,7-tetraen-2-amine is CC(C)C1=CC=C(N)N=C=C1.
What is the InChIKey of 5-propan-2-yl-1-azacyclohepta-2,4,6,7-tetraen-2-amine?
The InChIKey is ZZDLVXRQEQWPQW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2/c1-7(2)8-3-4-9(10)11-6-5-8/h3-5,7H,10H2,1-2H3.
What are the key properties of 5-propan-2-yl-1-azacyclohepta-2,4,6,7-tetraen-2-amine?
5-propan-2-yl-1-azacyclohepta-2,4,6,7-tetraen-2-amine has a molecular weight of 148.21 g/mol, XLogP of 1.61, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-propan-2-yl-1-azacyclohepta-2,4,6,7-tetraen-2-amine is sourced from PubChem (CID 130368208), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).