About 2-[3-(4,4-difluoropiperidin-1-yl)-2-methylpropyl]-4-(2-methylpropyl)morpholine
2-[3-(4,4-difluoropiperidin-1-yl)-2-methylpropyl]-4-(2-methylpropyl)morpholine (PubChem CID 130368452) has the molecular formula C17H32F2N2O
and a molecular weight of 318.45 g/mol. Its IUPAC name is 2-[3-(4,4-difluoropiperidin-1-yl)-2-methylpropyl]-4-(2-methylpropyl)morpholine.
Molecular Properties
| Compound Name | 2-[3-(4,4-difluoropiperidin-1-yl)-2-methylpropyl]-4-(2-methylpropyl)morpholine |
| PubChem CID | 130368452 |
| Molecular Formula | C17H32F2N2O |
| Molecular Weight | 318.45 g/mol |
| Exact Mass | 318.25 |
| IUPAC Name | 2-[3-(4,4-difluoropiperidin-1-yl)-2-methylpropyl]-4-(2-methylpropyl)morpholine |
| SMILES | CC(C)CN1CCOC(CC(C)CN2CCC(F)(F)CC2)C1 |
| InChI | InChI=1S/C17H32F2N2O/c1-14(2)11-21-8-9-22-16(13-21)10-15(3)12-20-6-4-17(18,19)5-7-20/h14-16H,4-13H2,1-3H3 |
| InChIKey | VWQHKMSALKPZCM-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.45 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[3-(4,4-difluoropiperidin-1-yl)-2-methylpropyl]-4-(2-methylpropyl)morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-(4,4-difluoropiperidin-1-yl)-2-methylpropyl]-4-(2-methylpropyl)morpholine?
The IUPAC name of 2-[3-(4,4-difluoropiperidin-1-yl)-2-methylpropyl]-4-(2-methylpropyl)morpholine (CID 130368452) is 2-[3-(4,4-difluoropiperidin-1-yl)-2-methylpropyl]-4-(2-methylpropyl)morpholine.
What is the SMILES notation for 2-[3-(4,4-difluoropiperidin-1-yl)-2-methylpropyl]-4-(2-methylpropyl)morpholine?
The canonical SMILES for 2-[3-(4,4-difluoropiperidin-1-yl)-2-methylpropyl]-4-(2-methylpropyl)morpholine is CC(C)CN1CCOC(CC(C)CN2CCC(F)(F)CC2)C1.
What is the InChIKey of 2-[3-(4,4-difluoropiperidin-1-yl)-2-methylpropyl]-4-(2-methylpropyl)morpholine?
The InChIKey is VWQHKMSALKPZCM-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H32F2N2O/c1-14(2)11-21-8-9-22-16(13-21)10-15(3)12-20-6-4-17(18,19)5-7-20/h14-16H,4-13H2,1-3H3.
What are the key properties of 2-[3-(4,4-difluoropiperidin-1-yl)-2-methylpropyl]-4-(2-methylpropyl)morpholine?
2-[3-(4,4-difluoropiperidin-1-yl)-2-methylpropyl]-4-(2-methylpropyl)morpholine has a molecular weight of 318.45 g/mol, XLogP of 3.10, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-(4,4-difluoropiperidin-1-yl)-2-methylpropyl]-4-(2-methylpropyl)morpholine is sourced from PubChem (CID 130368452), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).