C14H18N2O — CID 130369229
2-methyl-5-[(4Z,6Z)-3-methylideneocta-4,6-dienyl]-1H-pyrimidin-6-one (PubChem CID 130369229) has the molecular formula C14H18N2O and a molecular weight of 230.31 g/mol. Its IUPAC name is 2-methyl-5-[(4Z,6Z)-3-methylideneocta-4,6-dienyl]-1H-pyrimidin-6-one.
| Compound Name | 2-methyl-5-[(4Z,6Z)-3-methylideneocta-4,6-dienyl]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 130369229 |
| Molecular Formula | C14H18N2O |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.14 |
| IUPAC Name | 2-methyl-5-[(4Z,6Z)-3-methylideneocta-4,6-dienyl]-1H-pyrimidin-6-one |
| SMILES | C=C(/C=C\C=C/C)CCc1cnc(C)[nH]c1=O |
| InChI | InChI=1S/C14H18N2O/c1-4-5-6-7-11(2)8-9-13-10-15-12(3)16-14(13)17/h4-7,10H,2,8-9H2,1,3H3,(H,15,16,17)/b5-4-,7-6- |
| InChIKey | ZTIDWUDNHIGRHZ-RZSVFLSASA-N |
| XLogP | 2.70 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|