C9H12N2OS — CID 13036998
4,5,6,7-tetrahydro-1-benzothiophen-4-ylurea (PubChem CID 13036998) has the molecular formula C9H12N2OS and a molecular weight of 196.28 g/mol. Its IUPAC name is 4,5,6,7-tetrahydro-1-benzothiophen-4-ylurea.
| Compound Name | 4,5,6,7-tetrahydro-1-benzothiophen-4-ylurea |
|---|---|
| PubChem CID | 13036998 |
| Molecular Formula | C9H12N2OS |
| Molecular Weight | 196.28 g/mol |
| Exact Mass | 196.07 |
| IUPAC Name | 4,5,6,7-tetrahydro-1-benzothiophen-4-ylurea |
| SMILES | NC(=O)NC1CCCc2sccc21 |
| InChI | InChI=1S/C9H12N2OS/c10-9(12)11-7-2-1-3-8-6(7)4-5-13-8/h4-5,7H,1-3H2,(H3,10,11,12) |
| InChIKey | IIJKXCGKMNFKKF-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.28 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |