C10H8Cl3NO2S — CID 13037010
2,2,2-trichloro-N-(7-oxo-5,6-dihydro-4H-1-benzothiophen-4-yl)acetamide (PubChem CID 13037010) has the molecular formula C10H8Cl3NO2S and a molecular weight of 312.61 g/mol. Its IUPAC name is 2,2,2-trichloro-N-(7-oxo-5,6-dihydro-4H-1-benzothiophen-4-yl)acetamide.
| Compound Name | 2,2,2-trichloro-N-(7-oxo-5,6-dihydro-4H-1-benzothiophen-4-yl)acetamide |
|---|---|
| PubChem CID | 13037010 |
| Molecular Formula | C10H8Cl3NO2S |
| Molecular Weight | 312.61 g/mol |
| Exact Mass | 310.93 |
| IUPAC Name | 2,2,2-trichloro-N-(7-oxo-5,6-dihydro-4H-1-benzothiophen-4-yl)acetamide |
| SMILES | O=C1CCC(NC(=O)C(Cl)(Cl)Cl)c2ccsc21 |
| InChI | InChI=1S/C10H8Cl3NO2S/c11-10(12,13)9(16)14-6-1-2-7(15)8-5(6)3-4-17-8/h3-4,6H,1-2H2,(H,14,16) |
| InChIKey | QNLJYFUIWKDPMY-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.61 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|