C9H9F2N — CID 130370171
(2Z,4Z,6E)-3,7-difluoro-2-methylocta-2,4,6-trienenitrile (PubChem CID 130370171) has the molecular formula C9H9F2N and a molecular weight of 169.17 g/mol. Its IUPAC name is (2Z,4Z,6E)-3,7-difluoro-2-methylocta-2,4,6-trienenitrile.
| Compound Name | (2Z,4Z,6E)-3,7-difluoro-2-methylocta-2,4,6-trienenitrile |
|---|---|
| PubChem CID | 130370171 |
| Molecular Formula | C9H9F2N |
| Molecular Weight | 169.17 g/mol |
| Exact Mass | 169.07 |
| IUPAC Name | (2Z,4Z,6E)-3,7-difluoro-2-methylocta-2,4,6-trienenitrile |
| SMILES | C/C(C#N)=C(F)\C=C/C=C(\C)F |
| InChI | InChI=1S/C9H9F2N/c1-7(6-12)9(11)5-3-4-8(2)10/h3-5H,1-2H3/b5-3-,8-4+,9-7- |
| InChIKey | FJGRRSNAROQMQT-YYXRYFKXSA-N |
| XLogP | 3.18 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.17 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|