About (1R)-4-dimethylphosphoryl-6-propan-2-ylsulfonylcyclohexa-2,4-dien-1-amine
(1R)-4-dimethylphosphoryl-6-propan-2-ylsulfonylcyclohexa-2,4-dien-1-amine (PubChem CID 130370610) has the molecular formula C11H20NO3PS
and a molecular weight of 277.33 g/mol. Its IUPAC name is (1R)-4-dimethylphosphoryl-6-propan-2-ylsulfonylcyclohexa-2,4-dien-1-amine.
Molecular Properties
| Compound Name | (1R)-4-dimethylphosphoryl-6-propan-2-ylsulfonylcyclohexa-2,4-dien-1-amine |
| PubChem CID | 130370610 |
| Molecular Formula | C11H20NO3PS |
| Molecular Weight | 277.33 g/mol |
| Exact Mass | 277.09 |
| IUPAC Name | (1R)-4-dimethylphosphoryl-6-propan-2-ylsulfonylcyclohexa-2,4-dien-1-amine |
| SMILES | CC(C)S(=O)(=O)C1C=C(P(C)(C)=O)C=C[C@H]1N |
| InChI | InChI=1S/C11H20NO3PS/c1-8(2)17(14,15)11-7-9(16(3,4)13)5-6-10(11)12/h5-8,10-11H,12H2,1-4H3/t10-,11?/m1/s1 |
| InChIKey | VCBUNAJTNHDRIQ-NFJWQWPMSA-N |
| XLogP | 1.58 |
| TPSA | 77.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.33 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze (1R)-4-dimethylphosphoryl-6-propan-2-ylsulfonylcyclohexa-2,4-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R)-4-dimethylphosphoryl-6-propan-2-ylsulfonylcyclohexa-2,4-dien-1-amine?
The IUPAC name of (1R)-4-dimethylphosphoryl-6-propan-2-ylsulfonylcyclohexa-2,4-dien-1-amine (CID 130370610) is (1R)-4-dimethylphosphoryl-6-propan-2-ylsulfonylcyclohexa-2,4-dien-1-amine.
What is the SMILES notation for (1R)-4-dimethylphosphoryl-6-propan-2-ylsulfonylcyclohexa-2,4-dien-1-amine?
The canonical SMILES for (1R)-4-dimethylphosphoryl-6-propan-2-ylsulfonylcyclohexa-2,4-dien-1-amine is CC(C)S(=O)(=O)C1C=C(P(C)(C)=O)C=C[C@H]1N.
What is the InChIKey of (1R)-4-dimethylphosphoryl-6-propan-2-ylsulfonylcyclohexa-2,4-dien-1-amine?
The InChIKey is VCBUNAJTNHDRIQ-NFJWQWPMSA-N. The full InChI is InChI=1S/C11H20NO3PS/c1-8(2)17(14,15)11-7-9(16(3,4)13)5-6-10(11)12/h5-8,10-11H,12H2,1-4H3/t10-,11?/m1/s1.
What are the key properties of (1R)-4-dimethylphosphoryl-6-propan-2-ylsulfonylcyclohexa-2,4-dien-1-amine?
(1R)-4-dimethylphosphoryl-6-propan-2-ylsulfonylcyclohexa-2,4-dien-1-amine has a molecular weight of 277.33 g/mol, XLogP of 1.58, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (1R)-4-dimethylphosphoryl-6-propan-2-ylsulfonylcyclohexa-2,4-dien-1-amine is sourced from PubChem (CID 130370610), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).