C31H51FN2 — CID 130370887
(2E,4Z)-7-[[3-[(1Z,3E)-3-fluoropenta-1,3-dienyl]-4-methyl-1-[2-(methylamino)ethyl]cyclohex-3-en-1-yl]methyl]-N,2,6-trimethyl-3-(2-methylpropyl)octa-2,4,7-trien-1-amine (PubChem CID 130370887) has the molecular formula C31H51FN2 and a molecular weight of 470.76 g/mol. Its IUPAC name is (2E,4Z)-7-[[3-[(1Z,3E)-3-fluoropenta-1,3-dienyl]-4-methyl-1-[2-(methylamino)ethyl]cyclohex-3-en-1-yl]methyl]-N,2,6-trimethyl-3-(2-methylpropyl)octa-2,4,7-trien-1-amine.
| Compound Name | (2E,4Z)-7-[[3-[(1Z,3E)-3-fluoropenta-1,3-dienyl]-4-methyl-1-[2-(methylamino)ethyl]cyclohex-3-en-1-yl]methyl]-N,2,6-trimethyl-3-(2-methylpropyl)octa-2,4,7-trien-1-amine |
|---|---|
| PubChem CID | 130370887 |
| Molecular Formula | C31H51FN2 |
| Molecular Weight | 470.76 g/mol |
| Exact Mass | 470.40 |
| IUPAC Name | (2E,4Z)-7-[[3-[(1Z,3E)-3-fluoropenta-1,3-dienyl]-4-methyl-1-[2-(methylamino)ethyl]cyclohex-3-en-1-yl]methyl]-N,2,6-trimethyl-3-(2-methylpropyl)octa-2,4,7-trien-1-amine |
| SMILES | C=C(CC1(CCNC)CCC(C)=C(/C=C\C(F)=C/C)C1)C(C)/C=C\C(CC(C)C)=C(/C)CNC |
| InChI | InChI=1S/C31H51FN2/c1-10-30(32)14-13-29-21-31(17-18-33-8,16-15-25(29)5)20-26(6)24(4)11-12-28(19-23(2)3)27(7)22-34-9/h10-14,23-24,33-34H,6,15-22H2,1-5,7-9H3/b12-11-,14-13-,28-27-,30-10+ |
| InChIKey | XVAMGKJVQPJQBM-DQGAFGFRSA-N |
| XLogP | 8.23 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.76 |
| LogP ≤ 5 | 8.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|