C26H35N — CID 130370934
1'-[(3E,4Z)-3-(2-methylprop-2-enylidene)hepta-1,4-dien-2-yl]spiro[1,2,4,7-tetrahydrobenzo[7]annulene-3,4'-piperidine] (PubChem CID 130370934) has the molecular formula C26H35N and a molecular weight of 361.57 g/mol. Its IUPAC name is 1'-[(3E,4Z)-3-(2-methylprop-2-enylidene)hepta-1,4-dien-2-yl]spiro[1,2,4,7-tetrahydrobenzo[7]annulene-3,4'-piperidine].
| Compound Name | 1'-[(3E,4Z)-3-(2-methylprop-2-enylidene)hepta-1,4-dien-2-yl]spiro[1,2,4,7-tetrahydrobenzo[7]annulene-3,4'-piperidine] |
|---|---|
| PubChem CID | 130370934 |
| Molecular Formula | C26H35N |
| Molecular Weight | 361.57 g/mol |
| Exact Mass | 361.28 |
| IUPAC Name | 1'-[(3E,4Z)-3-(2-methylprop-2-enylidene)hepta-1,4-dien-2-yl]spiro[1,2,4,7-tetrahydrobenzo[7]annulene-3,4'-piperidine] |
| SMILES | C=C(C)/C=C(\C=C/CC)C(=C)N1CCC2(CCC3=C(C=CCC=C3)C2)CC1 |
| InChI | InChI=1S/C26H35N/c1-5-6-10-24(19-21(2)3)22(4)27-17-15-26(16-18-27)14-13-23-11-8-7-9-12-25(23)20-26/h6,8-12,19H,2,4-5,7,13-18,20H2,1,3H3/b10-6-,24-19+ |
| InChIKey | OLZJNSJUVFJTHY-LHYWDKFOSA-N |
| XLogP | 7.05 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.57 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|