About 11-butyl-8-[(4Z)-hexa-2,4-dienyl]-3-methyl-3-azaspiro[5.5]undec-8-ene
11-butyl-8-[(4Z)-hexa-2,4-dienyl]-3-methyl-3-azaspiro[5.5]undec-8-ene (PubChem CID 130371397) has the molecular formula C21H35N
and a molecular weight of 301.52 g/mol. Its IUPAC name is 11-butyl-8-[(4Z)-hexa-2,4-dienyl]-3-methyl-3-azaspiro[5.5]undec-8-ene.
Molecular Properties
| Compound Name | 11-butyl-8-[(4Z)-hexa-2,4-dienyl]-3-methyl-3-azaspiro[5.5]undec-8-ene |
| PubChem CID | 130371397 |
| Molecular Formula | C21H35N |
| Molecular Weight | 301.52 g/mol |
| Exact Mass | 301.28 |
| IUPAC Name | 11-butyl-8-[(4Z)-hexa-2,4-dienyl]-3-methyl-3-azaspiro[5.5]undec-8-ene |
| SMILES | C/C=C\C=CCC1=CCC(CCCC)C2(CCN(C)CC2)C1 |
| InChI | InChI=1S/C21H35N/c1-4-6-8-9-10-19-12-13-20(11-7-5-2)21(18-19)14-16-22(3)17-15-21/h4,6,8-9,12,20H,5,7,10-11,13-18H2,1-3H3/b6-4-,9-8? |
| InChIKey | RHLLLVOUVFGWBM-GWJDWTGUSA-N |
| XLogP | 5.75 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 301.52 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 11-butyl-8-[(4Z)-hexa-2,4-dienyl]-3-methyl-3-azaspiro[5.5]undec-8-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 11-butyl-8-[(4Z)-hexa-2,4-dienyl]-3-methyl-3-azaspiro[5.5]undec-8-ene?
The IUPAC name of 11-butyl-8-[(4Z)-hexa-2,4-dienyl]-3-methyl-3-azaspiro[5.5]undec-8-ene (CID 130371397) is 11-butyl-8-[(4Z)-hexa-2,4-dienyl]-3-methyl-3-azaspiro[5.5]undec-8-ene.
What is the SMILES notation for 11-butyl-8-[(4Z)-hexa-2,4-dienyl]-3-methyl-3-azaspiro[5.5]undec-8-ene?
The canonical SMILES for 11-butyl-8-[(4Z)-hexa-2,4-dienyl]-3-methyl-3-azaspiro[5.5]undec-8-ene is C/C=C\C=CCC1=CCC(CCCC)C2(CCN(C)CC2)C1.
What is the InChIKey of 11-butyl-8-[(4Z)-hexa-2,4-dienyl]-3-methyl-3-azaspiro[5.5]undec-8-ene?
The InChIKey is RHLLLVOUVFGWBM-GWJDWTGUSA-N. The full InChI is InChI=1S/C21H35N/c1-4-6-8-9-10-19-12-13-20(11-7-5-2)21(18-19)14-16-22(3)17-15-21/h4,6,8-9,12,20H,5,7,10-11,13-18H2,1-3H3/b6-4-,9-8?.
What are the key properties of 11-butyl-8-[(4Z)-hexa-2,4-dienyl]-3-methyl-3-azaspiro[5.5]undec-8-ene?
11-butyl-8-[(4Z)-hexa-2,4-dienyl]-3-methyl-3-azaspiro[5.5]undec-8-ene has a molecular weight of 301.52 g/mol, XLogP of 5.75, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 11-butyl-8-[(4Z)-hexa-2,4-dienyl]-3-methyl-3-azaspiro[5.5]undec-8-ene is sourced from PubChem (CID 130371397), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).