C8H14N2 — CID 130371607
(3E)-2-N,2-N-dimethylhexa-1,3,5-triene-2,3-diamine (PubChem CID 130371607) has the molecular formula C8H14N2 and a molecular weight of 138.21 g/mol. Its IUPAC name is (3E)-2-N,2-N-dimethylhexa-1,3,5-triene-2,3-diamine.
| Compound Name | (3E)-2-N,2-N-dimethylhexa-1,3,5-triene-2,3-diamine |
|---|---|
| PubChem CID | 130371607 |
| Molecular Formula | C8H14N2 |
| Molecular Weight | 138.21 g/mol |
| Exact Mass | 138.12 |
| IUPAC Name | (3E)-2-N,2-N-dimethylhexa-1,3,5-triene-2,3-diamine |
| SMILES | C=C/C=C(/N)C(=C)N(C)C |
| InChI | InChI=1S/C8H14N2/c1-5-6-8(9)7(2)10(3)4/h5-6H,1-2,9H2,3-4H3/b8-6+ |
| InChIKey | PLNMFUYOIDFGDT-SOFGYWHQSA-N |
| XLogP | 1.09 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.21 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|