C17H17IO4 — CID 130371737
[(1S,3R,5S,6R,10R)-6-hydroxy-5-methyl-9-oxo-11-oxapentacyclo[8.7.0.01,6.03,16.012,17]heptadeca-12,14,16-trien-13-yl] hypoiodite (PubChem CID 130371737) has the molecular formula C17H17IO4 and a molecular weight of 412.22 g/mol. Its IUPAC name is [(1S,3R,5S,6R,10R)-6-hydroxy-5-methyl-9-oxo-11-oxapentacyclo[8.7.0.01,6.03,16.012,17]heptadeca-12,14,16-trien-13-yl] hypoiodite.
| Compound Name | [(1S,3R,5S,6R,10R)-6-hydroxy-5-methyl-9-oxo-11-oxapentacyclo[8.7.0.01,6.03,16.012,17]heptadeca-12,14,16-trien-13-yl] hypoiodite |
|---|---|
| PubChem CID | 130371737 |
| Molecular Formula | C17H17IO4 |
| Molecular Weight | 412.22 g/mol |
| Exact Mass | 412.02 |
| IUPAC Name | [(1S,3R,5S,6R,10R)-6-hydroxy-5-methyl-9-oxo-11-oxapentacyclo[8.7.0.01,6.03,16.012,17]heptadeca-12,14,16-trien-13-yl] hypoiodite |
| SMILES | C[C@H]1C[C@@H]2C[C@]34c5c2ccc(OI)c5O[C@H]3C(=O)CC[C@@]14O |
| InChI | InChI=1S/C17H17IO4/c1-8-6-9-7-16-13-10(9)2-3-12(22-18)14(13)21-15(16)11(19)4-5-17(8,16)20/h2-3,8-9,15,20H,4-7H2,1H3/t8-,9+,15-,16-,17+/m0/s1 |
| InChIKey | LEPICGAMBMMIJL-GOLZTBMGSA-N |
| XLogP | 3.04 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.22 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|