C26H45N — CID 130371881
(2E,4E,6E)-2-[(Z)-but-2-enylidene]-4,7,8,8-tetramethyl-3-methylidene-N-(2-propylpentyl)nona-4,6-dien-1-amine (PubChem CID 130371881) has the molecular formula C26H45N and a molecular weight of 371.65 g/mol. Its IUPAC name is (2E,4E,6E)-2-[(Z)-but-2-enylidene]-4,7,8,8-tetramethyl-3-methylidene-N-(2-propylpentyl)nona-4,6-dien-1-amine.
| Compound Name | (2E,4E,6E)-2-[(Z)-but-2-enylidene]-4,7,8,8-tetramethyl-3-methylidene-N-(2-propylpentyl)nona-4,6-dien-1-amine |
|---|---|
| PubChem CID | 130371881 |
| Molecular Formula | C26H45N |
| Molecular Weight | 371.65 g/mol |
| Exact Mass | 371.36 |
| IUPAC Name | (2E,4E,6E)-2-[(Z)-but-2-enylidene]-4,7,8,8-tetramethyl-3-methylidene-N-(2-propylpentyl)nona-4,6-dien-1-amine |
| SMILES | C=C(/C(C)=C/C=C(\C)C(C)(C)C)/C(=C\C=C/C)CNCC(CCC)CCC |
| InChI | InChI=1S/C26H45N/c1-10-13-16-25(20-27-19-24(14-11-2)15-12-3)23(6)21(4)17-18-22(5)26(7,8)9/h10,13,16-18,24,27H,6,11-12,14-15,19-20H2,1-5,7-9H3/b13-10-,21-17+,22-18+,25-16- |
| InChIKey | NUWIPNDGOIAWKL-KMDLHSKVSA-N |
| XLogP | 7.79 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.65 |
| LogP ≤ 5 | 7.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|